Metabolic Pathways and ATP Production

An Introduction to General, Organic, and Biological Chemistry ยท 96 exercises

Q. 18.49

What is meant by oxidative phosphorylation?

2 step solution

Q. 18.50

How is the H+ gradient established?

2 step solution

Q. 18.51

According to the chemiosmotic theory, how does the H+ gradient provide energy to synthesize ATP?

2 step solution

Q. 18.52

How does the phosphorylation of ADP occur?

2 step solution

Q. 18.53

How are glycolysis and the citric acid cycle linked to the production of ATP by electron transport?

2 step solution

Q. 18.54

Why does FADH2 yield data-custom-editor="chemistry" 1.5 ATP, using the electron transport system, but data-custom-editor="chemistry" NADH yields data-custom-editor="chemistry" 2.5 ATP?

2 step solution

Q. 18.55

What is the ATP energy yield associated with each of the following?

a. NADH NAD+ 

b. glucose 2 pyruvate

c. 2 pyruvate 2 acetyl CoA + 2CO2

d. acetyl CoA 2CO2

8 step solution

Q. 18.56

What is the ATP energy yield associated with each of the following?

a. FADH2 FAD

b. glucose + 6026CO2+6H2O 

c. glucose  2 lactate

d. pyruvatelactate

8 step solution

Q.18.57

Caprylic acid CH3-CH26-COOH is a C8  fatty acid found in milk.


a. State the number of β-oxidation cycles for the complete oxidation of caprylic acid.

b.  State the number of acetyl CoA from the complete oxidation of caprylic acid.

c. How many ATP are generated from the oxidation of caprylic acid.

6 step solution

Q. 18.61

When are ketone bodies produced in the body?

2 step solution

Q. 18.62

Why could a person who is fasting have high levels of acetyl CoA?

2 step solution

Q. 18.63

What are some condition that characteristics ketosis? 

2 step solution

Q. 18.64

Why do diabetics produce high levels of ketone bodies?

2 step solution

Q. 18.60

Consider the complete oxidation of palmitoleic acid, CH3-(CH2)-CH=CH-(CH2)7-COOH, which is a C16 monounsaturated fatty acid found in animal and vegetable oils.

a. How many cycles of  β-oxidation are needed?

b. How many acetyl CoA are produced? 

c. How many ATP are generated from the oxidation of palmitoleic acid?

6 step solution

Q. 18.59

Consider the complete oxidation of oleic acid, CH3-(CH2)7-CH=CH-(CH2)7-COOH, which is a C18 monounsaturated fatty acid.

a. How many cycles of  β-oxidation are needed?

b. How many acetyl CoA are produced?

c. How many ATP are generated from the oxidation of oleic acid?

6 step solution

Q. 18.58

Lignoceric acid, CH3-(CH2)22-COOH, is a C24 fatty acid found in peanut oil in small amounts.

a. State the number of β-oxidation cycles for the complete oxidation of lignoceric acid.

b. State the number of acetyl CoA from the complete oxidation of lignoceric acid. 

c. How many ATP are generated from the complete oxidation of lignoceric acid?

6 step solution

Q. 18.67

Why does the body convert NH4+ to urea?

2 step solution

Q. 18.68

Draw the condensed structural formula for urea.

2 step solution

Q. 18.70

What metabolic substrate(s) are produced from the carbon atoms of each of the following amino acids? 

a. leucine

b. asparagine

c. cysteine

d. arginine

8 step solution

Q. 18.66

Draw the condensed structural formula for the α-keto acid produced from each of the following in transamination:

a. 

b.

4 step solution

Q. 18.65

Draw the condensed structural formula for the α-keto acid produced from each of the following in transamination:

a.

b.

4 step solution

Q. 18.71

Draw the condensed structural formulas for the products of the reaction of alanine and α-ketoglutarate, which is catalyzed by alanine transaminase (ALT).

2 step solution

Q. 18.72

Draw the condensed structural formulas for the products of the reaction of aspartate and α-ketoglutarate, which is catalyzed by aspartate transaminase (AST).

2 step solution

Q. 18.76

Identify each of the following as a six-carbon or a three-carbon compound and arrange them in the order in which they occur in glycolysis:

a. 3-phosphoglycerate

b. pyruvate

c. glucose-6-phosphate

d. glucose

e. fructose-1,6-bisphosphate

10 step solution

Q. 18.73

Lauric acid is a C12 fatty acid found in coconut oil.

a. How many cycles of β oxidation are needed for the complete oxidation of lauric acid?
b. How many acetyl CoA are produced from the complete oxidation of lauric acid?
c. Calculate the total ATP yield from the complete β oxidation of lauric acid by completing the following:


6 step solution

Q. 18.74


Arachidic acid is a C20 fatty acid found in peanut and fish oils.

a. How many cycles of β oxidation are needed for the complete oxidation of arachidic acid?
b. How many acetyl CoA are produced from the complete oxidation of arachidic acid?
c. Calculate the total ATP yield from the complete β oxidation of arachidic acid by completing the following:




6 step solution

Q. 18.75

 Identify the type of food as carbohydrate, fat, or protein that gives each of the following digestion products:
a. glucose
b. fatty acid
c. maltose
d. glycerol
e. amino acids
f. dextrins

12 step solution

Q.18.97

Which of the following molecules will produce the most ATP mole?

a. glucose or maltose

b. myristic acid or stearic acid

c. glucose or two acetyl CoA

d. glucose or caprylic acid (C8)

e. citrate or succinate in one term of citric acid cycle

1 step solution

Q. 18.86

Most metabolic pathways are not cycles. Why is the citric acid cycle considered to be a metabolic cycle?(18.5)

2 step solution

Q. 18.87

If there are no reactions in the citric acid cycle that use oxygen,O2, why does the cycle operate only in aerobic conditions? (18.5)

2 step solution

Q. 18.88

What products of the citric acid cycle are needed for electron transport? (18.5 ,18.6)

2 step solution

Q. 18.89

In the chemiosmotic model, how is energy provided to synthesize ATP ?(18.6)

2 step solution

Q. 18.90

What is the effect of H+ accumulation in the intermembrane space? (18.6)

2 step solution

Q. 18.77

Write an equation for the hydrolysis of ATP to ADP.

2 step solution

Q. 18.91

How many ATP are produced when glucose is oxidized to pyruvate, compared to when glucose is oxidized to CO2 and H2O ? (18.4 ,18.5 ,18.6)

2 step solution

Q. 18.78

At the gym, you expend 310 kcal riding the stationary bicycle for 1 h. How many moles of ATP will this require?

2 step solution

Q. 18.79

How and where does lactose undergo digestion in the body? What are the products?

2 step solution

Q. 18.81

What are the reactant and product of glycolysis?

2 step solution

Q. 18.80

How and where does sucrose undergo digestion in the body? What are the products?

2 step solution

Q. 18.82

What is the general type of reaction that takes place in the digestion of carbohydrates?

2 step solution

Q. 18.83

When is pyruvate converted to locate in the body?

2 step solution

Q. 18.84

When pyruvate is used to form acetyl CoA, the product has only two carbon atoms. What happened to the third carbon?


2 step solution

Q. 18.85

What is the main function of the citric acid cycle?

2 step solution

Q. 18.92

What metabolic substrates can be produced from the carbon atoms of each of the following amino acids?

a. histidine

b. isoleucine 

c. serine

d. phenylalanine

8 step solution

Q. 18.93

One cell at work may break down a 2 million 2000000ATP molecules in one second. Some researchers estimate that the human body has about 1013cells. (18.1)

a. How much energy, in Kilocalories, would be used by the cells in the body in one day?

b. If ATP has a molar mass of 507  gmole, how many grams of ATP is hydrolyzed in one day?

4 step solution

Q. 18.98

Which of the following molecules will produce the most ATP per mole? (18.5 , 18.6)

a. glucose or stearic acid (C18)

b. glucose or two pyruvate

c. two acetyl  CoA or one palmitic acid  (C16)

d. lauric acid (C12) or palmitic acid (C16)

e. αketoglutarate  or fumarate in one turn of the citric acid cycle." width="9" style="max-width: none;" >


10 step solution

Show/ page