Chemical Quantities and Reactions

An Introduction to General, Organic, and Biological Chemistry ยท 115 exercises

Q. 7.51

When linoleic acid, an unsaturated fatty acid, reacts with hydrogen, it forms a saturated fatty acid. Is linoleic acid oxidized or reduced in the hydrogenation reaction? 

 C18H32O2 + 2H2  C18H36O2 

Linoleic acid

2 step solution

Q. 7.52

In one of the reactions in the citric acid cycle, which provides energy, succinic acid is converted to fumaric acid. 

C4H6O4  C4H4O4 + 2H

Succinic acid    Fumaric acid 

The reaction is accompanied by a coenzyme, flavin adenine dinucleotide 

 FAD + 2H  FADH2

a. Is succinic acid oxidized or reduced? 

b. Is FAD oxidized or reduced? 

c. Why would the two reactions occur together?

6 step solution

Q. 7.48

In each of the following, identify the reactant that is oxidized and the reactant that is reduced: 

a)2Li(s) + F2(g) 2LiF(s) 

b) Cl2(g) + 2KI(aq)  I(s) + 2KCl(aq) 

c)2Al(s) + 3Sn2+(aq)  3Sn(s) + 2Al3+(aq) 

d)Fe(s) + CuSO4(aq)  Cu(s) + FeSO4(aq) 

8 step solution

Q. 7.53

Write all of the mole-mole factors for each of the following chemical equations: 

a.2SO2(g)+O2g2SO3g

b.data-custom-editor="chemistry" 4P(s)+5O2(g)2P2O5(s)

4 step solution

Q. 7.54

Write all of the mole-mole factors for each of the following chemical equations:

a. 2Al(s) + 3Cl2(g)  2AICI3(s)

b. 4HCI(g) + O2(g) 2Cl2(g) + 2H2O(g)

4 step solution

Q. 7.55

The chemical reaction of hydrogen with oxygen produces water. 

2H2(g) + O2(g)  2H2O(g)

a. How many moles of O2are required to react with 2.6 moles of H?

b. How many moles of H2are needed to react with 5.0 moles ofO2?

c. How many moles of H2Oform when 2.5 moles of O2react?

6 step solution

Q. 7.57

Carbon disulfide and carbon monoxide are produced when carbon is heated with sulfur dioxide.

a. How many moles of C are needed to react with 0.500 mole of SO2?

b. How many moles of CO are produced when 1.2moles of C reacts?

c. How many moles of SO2 are needed to produce 0.50mole of CS2?

d. How many moles of CS2 are produced when 2.5moles of C reacts?

8 step solution

Q. 7.60

Nitrogen gas reacts with hydrogen gas to produce ammonia.

N2(g) + 3H2(g) 2NH3(g)

(a) If you have 3.64 g of H, how many grams of NH3 can be

produced? 

(b) How many grams of H, are needed to react with 2.80 g

of N? 

(c) How many grams of NH3 can be produced from 12.0 g

of H?

6 step solution

Q. 7.61

Ammonia and oxygen react to form nitrogen and water.

4NH3(g)+3O2(g)2N2(g)+6H2O(g)

a. How many grams of O2 are needed to react with13.6 g of NH3?

b. How many grams of N2 can be produced when6.50 g of O2 reacts?

c. How many grams of H2O are formed from the reaction of 34.0 g of NH3?

6 step solution

Q. 7.62

Iron(III) oxide reacts with carbon to give iron and carbon monoxide.

Fe2O3(s)+3C(s)2Fe(s)+3CO(g)

a. How many grams of C are required to react with 16.5 g of Fe2O3?

b. How many grams of CO are produced when36.0 g of Creacts ?

c. How many grams of Fe can be produced when 6.00 gof Fe2O3 reacts?

6 step solution

Q. 7.59

Sodium reacts with oxygen to produce sodium oxide.

a. How many grams of Na2O are produced when 57.5g of Na reacts?

b. If you have 18.0g of Na, how many grams of O2 are needed for the reaction?

c. How many grams of O2 are needed in a reaction that produces 75.0g of Na2O?

6 step solution

Q. 7.66

When the gases dihydrogen sulfide and oxygen react, they form the gases sulfur dioxide and water vapor.

a. Write the balanced chemical equation for the reaction.

b. How many grams of oxygen are needed to react with 2.50 g of dihydrogen sulfide?

c. How many grams of sulfur dioxide can be produced when 38.5 g of oxygen reacts?

d. How many grams of oxygen are needed to produce 55.8 g of water vapor?

8 step solution

Q. 7.65

When solid lead(II) sulfide reacts with oxygen gas, the products are solid lead(II) oxide and sulfur dioxide gas.

a. Write the balanced chemical equation for the reaction.

b. How many grams of oxygen are required to react with 29.9 g of lead(II) sulfide?

c. How many grams of sulfur dioxide can be produced when 65.0 g of lead(II) sulfide reacts?

d. How many grams of lead(II) sulfide are used to produce 128 g of lead(II) oxide?

8 step solution

Q. 7.63

Nitrogen dioxide and water react to produce nitric acid, HNO3 and nitrogen oxide.

3NO2(g)+H2O(l)2HNO3(aq)+NO(g)

a. How many grams of H2O are needed to react with 28.0 g of  NO2 ?

b. How many grams of NO are produced from 15.8 gof  H2O ?

c. How many grams of HNO3are produced from 8.25 g of NO2 ?

6 step solution

Q. 7.64

Calcium cyanamide, CaCN2 reacts with water to form calcium carbonate and ammonia.

CaCN2(s)+3H2O(l)CaCO3(s)+2NH3(g)

a. How many grams of H2O are needed to react with 75.0 gof CaCN2?

b. How many grams ofNH3 are produced from 5.24 g of CaCN2?

c. How many grams of CaCO3 form if  155 g of H2O reacts?

6 step solution

Q. 7.70

Classify each of the following as exothermic or endothermic:

a. The energy level of the products is lower than that of the reactants.

b. In the body, the synthesis of proteins requires energy.

c. A reaction absorbs 125 kJ.

6 step solution

Q. 7.69

Classify each of the following as exothermic or endothermic:

a. A reaction releases 550 kJ.

b. The energy level of the products is higher than that of the reactants.

c. The metabolism of glucose in the body provides energy.

6 step solution

Q. 7.68

a. What is measured by the heat of reaction?

b. In an endothermic reaction, is the energy of the products higher or lower than that of the reactants?

c. Draw an energy diagram for an endothermic reaction.

6 step solution

Q. 7.67

a. Why do chemical reactions require energy of activation ?

b. In an exothermic reaction, is the energy of the products higher or lower than that of the reactants?

c. Draw an energy diagram for an exothermic reaction.

6 step solution

Q. 7.71

Classify each of the following as exothermic or endothermic:

a. CH4 (g) + 2O2 (g)CO2 (g) + 2H2O (g) + 802 kJ

b. Ca(OH)2 (s) + 65.3 kJ  CaO (s) + H2O (l)

c. 2Al (s) + Fe2O3 (s) Al2O3 (s) + 2Fe (s) + 850 kJ

6 step solution

Q. 7.72

Classify each of the following as exothermic or endothermic: 

a. C3H8 (g) + 5O2 (g) 3CO2 (g) + 4H2O (g) + 2220 kJ

b. 2 Na (s) +Cl2 (g)2 NaCl (s) + 819 kJ

c. PCl5 (g) + 67 kJ PCl3 (g) + Cl2 (g)

6 step solution

Q. 7.73

a. What is meant by the rate of a reaction?

b. Why does bread grow mold more quickly at room temperature than in the refrigerator?

4 step solution

Q. 7.74

a. How does a catalyst affect the activation energy?

b. Why is pure oxygen used in respiratory distress?

4 step solution

Q. 7.75

How would each of the following change the rate of the reaction shown here?

2SO2(g) + O2(g) 2SO3(g)

a. adding some SO2(g)

b. increasing the temperature

c. adding a catalyst

d. removing some O2(g)

8 step solution

Q. 7.76

How would each of the following change the rate of the reaction shown here:

2NO(g) + 2H2(g) N2(g) + 2H20(g) 

a. adding some NO(g)

b. decreasing the temperature

c. removing some H2(g)

d. adding a catalyst

8 step solution

Q. 7.77

a. During cellular respiration, aqueous C6H12O6 (glucose) in the cells undergoes a reaction with oxygen gas to form gaseous carbon dioxide and liquid water. Write and balance the chemical equation for reaction of glucose in the human body.

b. In plants, carbon dioxide gas and liquid water are converted to aqueous glucose C6H12O6and oxygen gas. Write and balance the chemical equation for production of glucose in plants.

4 step solution

Q. 7.78

Fatty acids undergo reaction with oxygen gas and form gaseous carbon dioxide and liquid water when utilized for energy in the body.

(a)Write and balance the equation for the combustion of the fatty acid aqueous capric acid C10H20O2

(b)   Write and balance the equation for the combustion of the fatty acid aqueous myristic acid, C14H2802

4 step solution

Q. 7.80



Using the models of the molecules (black = C, white = H, yellow = S, red = O), determine each of the following for models of compounds 1 and 2:

(a). Molecular formula.

(b). Molar mass.

(c). No. of moles in 10 g.


6 step solution

Q. 7.79

Using the models of the molecules (black = C, white = H, yellow = S, green = Cl), determine each of the following for compounds 1and 2:

(a) Molecular formula.

(b) Molecular mass.

(c) No of moles in10 g .


6 step solution

Q. 7.81


A dandruff shampoo contains dipyrithione,C10H8N2O2S2 , which acts as an antibacterial and antifungal agent. 

  1. What is the molar mass of dipyrithione?
  2. How many moles of dipyrithione are in 25.0 g?
  3. How many moles of C are in 25.0 gof dipyrithione?

  4. How many moles of dipyrithione contain 8.2 ×1024atoms of N?



8 step solution

Q. 7.82

Ibuprofen, an anti-inflammatory drug in Advil, has the formula . C13H1802

Ibuprofen is an anti inflammatory.

  1. What is the molar mass of ibuprofen?
  2. How many grams of ibuprofen are in 0.525 mole?
  3. How many moles of C are in 12g of ibuprofen?
  4. How many moles of ibuprofen contain 1.22 x 1023 atoms of C?




8 step solution

Q. 7.83

Balance each of the following by adding coefficients, and identify the type of reaction for each: 


4 step solution

Q. 7.84


Balance each of the following by adding coefficients, and identify the type of reaction for each



4 step solution

Q. 7.85


If red spheres represent oxygen atoms, blue spheres represent nitrogen atoms, and all the Molecules are gases, 

  1. Write the formula for each of the reactants and products.
  2. Write a balanced equation for the reaction.
  3. Indicate the type of reaction as combination, decomposition, single replacement, double replacement, or combustion.

6 step solution

Q. 7.89


If green sphere represents the chlorine atoms and red sphere represents the oxygen atoms and all are gases.

  1. Write the formula for each of the reactants and products.     
  2. Write the balanced equation.
  3. Indicate the type of reaction as combination, decomposition, single replacement, double replacement, or combustion.

6 step solution

Q. 7.86


If purple spheres represent iodine atoms, white spheres represent hydrogen atoms, and all the molecules are gases

(a) Write the formula for each of the reactants and products.

(b) Write a balanced equation for the reaction.

(c) Indicate the type of reaction as combination, decomposition, single replacement, double replacement.

6 step solution

Q. 7.87


If blue spheres represent nitrogen atoms, purple spheres represent iodine atoms and the reacting molecules are solid, while the products are gases.



  1. Write the formula for each of the reactants and products.
  2. Write a balanced equation for the reaction.
  3. Indicate the type of reaction as combination, decomposition, single replacement, double replacement, or combustion.

6 step solution

Q. 7.88


If green spheres represent chlorine atoms, yellow-green spheres represent fluorine atoms, white spheres represent hydrogen atoms, and all the molecules are gases.



  1. Write the formula for each of the reactants and products.
  2. Write a balanced equation for the reaction.
  3. Indicate the type of reaction as combination, decomposition, single replacement, double replacement, or combustion.

6 step solution

Q. 7.90


If purple sphere represents the Iodine atoms and blue sphere represents the nitrogen atoms and reacting molecules are gases and products are solid.

  1. Write the formula for each of the reactants and products.     
  2. Write the balanced equation.
  3. Indicate the type of reaction as combination, decomposition, single replacement, double replacement, or combustion.

6 step solution

Q. 7.91

Calculate the molar mass for each of the following: (7.2)

a. data-custom-editor="chemistry" ZnSO4, zinc sulfate, zinc supplement

b. data-custom-editor="chemistry" CaIO32, calcium iodate, iodine source in table salt

c. data-custom-editor="chemistry" C5H8NNaO4,monosodium glutamate, flavor enhancer

d. data-custom-editor="chemistry" C6H12O2,isoamyl formate, used to make artificial fruit syrups

8 step solution

Q. 7.92

Calculate the molar mass for each of the following: (7.2)

a. data-custom-editor="chemistry" MgCO3, magnesium carbonate, used in antacids

b. data-custom-editor="chemistry" Au(OH)3, gold(III) hydroxide, used in gold plating

c. data-custom-editor="chemistry" C18H34O2, oleic acid, from olive oil

d. data-custom-editor="chemistry" C21H26O5, prednisone, anti-inflammatory

8 step solution

Q. 7.93

How many grams are in 0.150 mole of each of the following? (7.3)

a. K

b. Cl2

c. Na2CO3

6 step solution

Q. 7.94

How many grams are in 2.25 mole of each of the following? (7.3)

a. N2

b. NaBr

c. C6H14

6 step solution

Q. 7.95

How many moles are in 25.0 g of each of the following compounds? (7.3)

a. CO2

b. Al2O3

c. MgCl2

6 step solution

Q. 7.96

How many moles are in 4.00 g of each of the following compounds? (7.3)

a. NH3

b. Ca(NO3)2

c. SO3

6 step solution

Q. 7.97

Identify the type of reaction for each of the following as combination, decomposition, single replacement, double replacement, or combustion: (7.5)

a. A metal and a nonmetal form an ionic compound.

b. A compound of hydrogen and carbon reacts with oxygen to produce carbon dioxide and water. 

c. Heating calcium carbonate produces calcium oxide and carbon dioxide. 

d. Zinc replaces copper in data-custom-editor="chemistry" Cu(NO3)2.

8 step solution

Q. 7.98

Identify the type of reaction for each of the following as combination, decomposition, single replacement, double replacement, or combustion: (7.5)

a. A compound breaks apart into its elements. 

b. Copper and bromine form copper(II) bromide.

c. Iron(II) sulfite breaks down to iron(II) oxide and sulfur dioxide.

d. Silver ion from data-custom-editor="chemistry" AgNO3(aq.) forms a solid with bromide ion from data-custom-editor="chemistry" KBr(aq).

8 step solution

Q. 7.99

Balance each of the following chemical equations, and identify the type of reaction: (7.4, 7.5)

a. data-custom-editor="chemistry" NH3(g) + HCl(g) NH4Cl(s) 

b.  C4H8(g) + O2(g) CO2(g) + H2O(g)

c. data-custom-editor="chemistry" Sb(s) + Cl2(g)  SbCl3(s)

d. data-custom-editor="chemistry" NI3(s) N2(g) + I2(g) 

e. data-custom-editor="chemistry" KBr(aq) + Cl2(aq) KCl(aq) + Br2(l)

f. data-custom-editor="chemistry" Fe(s) + H2SO4(aq)  H2(g) + Fe2(SO4)3(aq)

g. data-custom-editor="chemistry" Al2(SO4)3(aq) + NaOH(aq) Al(OH)3(s) + Na2SO4(aq)

14 step solution

Q. 7.100

Balance each of the following chemical equations, and identify the type of reaction: (7.4, 7.5

a. Si3N4(s)  Si(s) + N2(g)

b. Mg(s) + N2(g)  Mg3N2(s)

c. Al(s) + H2PO4(aq)  H2(g) + AIPO4(aq)

d. C3H4(g) + O2(g) CO2(g) + H2O(g)

e. Cr2O3(s) + H2(g)Cr(s) + H2O(g)

f. Al(s) + Cl2(g) AlCl3(s)

g. MgCl2(aq) + AgNO3(aq)  AgCl(s) + Mg(NO3)2(aq)

14 step solution

Q. 7.101

Identify each of the following as an oxidation or a reduction: (7.6)

a. Zn2+(aq.)+2e-Zn(s)

b. Al(s)Al3+(aq)+3e--

c. Pb(s)Pb2+(aq)+2e-

d. Cl2(g)+2e-2Cl-(aq)

8 step solution

Show/ page