Problem 32

Question

Which of the following is the strongest acid ? (a) O=C(O)c1ccccc1[N+](=O)[O-] (b) O=C(O)c1ccc([N+](=O)[O-])cc1 (c) O=C(O)c1cccc([N+](=O)[O-])c1 (d) O=C(O)c1ccccc1

Step-by-Step Solution

Verified
Answer
Compound (a) is the strongest acid.
1Step 1: Identify the Acidic Group
Each of the given compounds contains a carboxylic acid group, represented by 'O=C(O)'. The strength of an acid is influenced by the stability of the conjugate base formed after deprotonation of this acidic hydrogen.
2Step 2: Analyze the Substituents' Effect on Acidity
Evaluate the substituents attached to the benzene ring in each compound. Nitro groups '[N+](=O)[O-]' are electron-withdrawing, which can stabilize the conjugate base by delocalizing negative charge, thereby increasing acidity.
3Step 3: Compare Substituent Positions
Observe the position of the nitro group relative to the carboxylic acid group in each compound: - (a) is ortho - (b) is para - (c) is meta - (d) has no nitro group. Electron-withdrawing groups in the ortho and para positions have a stronger effect on acidity than in the meta position.
4Step 4: Consider the Effect of Electron Withdrawal
The nitro group in position (a) is ortho, which offers maximum stabilization of the conjugate base, making it more effective than either para in (b) or meta in (c). The absence of a nitro group in (d) makes it the weakest acid.
5Step 5: Conclusion
Based on the position and effect of the nitro groups, compound (a) is the strongest acid due to the ortho position of the nitro group providing maximum stabilization of the carboxylate anion after deprotonation.

Key Concepts

Conjugate Base StabilityElectron-Withdrawing GroupsOrtho, Meta, Para PositionsCarboxylic Acid Group
Conjugate Base Stability
The stability of a conjugate base plays a crucial role in determining the strength of an acid. When an acid donates a proton, it forms a conjugate base. This base is often a negatively charged species, known as an anion. A more stable anion corresponds to a stronger acid because the acid is more inclined to lose a proton if the resulting anion is stable. Several factors contribute to the stability of the conjugate base: - **Resonance:** If the anion can delocalize its negative charge over multiple atoms through resonance, it is generally more stable. - **Electronegativity:** Anions formed on more electronegative atoms are more stable because electronegative atoms have a stronger ability to hold onto negative charge. - **Inductive Effect:** Nearby electronegative atoms or groups can stabilize the conjugate base via the inductive effect, which occurs through sigma bonds. This is where our electron-withdrawing groups come into play.
Electron-Withdrawing Groups
Electron-withdrawing groups (EWGs) such as nitro groups ([N+](=O)[O-]) can significantly influence acidity by stabilizing the conjugate base. These groups withdraw electron density through both inductive and resonance effects:
  • **Inductive Effect:** EWGs pull electron density away from the acidic proton through sigma bonds, making proton detachment easier.
  • **Resonance Effect:** If positioned appropriately on a benzene ring, these groups can delocalize the negative charge developed on the conjugate base, enhancing stability.
The presence and position of EWGs can make a molecule a more potent acid. In the context of our compounds, the nitro group is a classic example of an EWG, bolstering the acidity by stabilizing the conjugate base.
Ortho, Meta, Para Positions
The position of substituents on a benzene ring relative to functional groups like the carboxylic acid can immensely influence the acidity.
  • **Ortho Position:** When the EWG is directly adjacent to the acidic group, it can provide maximum inductive and resonance stabilization. This close proximity allows for the finest charge delocalization.
  • **Para Position:** The para position also allows for effective resonance stabilization through the benzene ring. However, it is generally somewhat less effective compared to the ortho position due to the increased distance.
  • **Meta Position:** Substituents at the meta position generally offer the least stabilization via resonance because the charge cannot be directly delocalized onto the substituent. The inductive effect is still present but is less impactful.
Thus, for maximizing acid strength, a substituent at the ortho position tends to create the strongest acid.
Carboxylic Acid Group
The carboxylic acid group, represented as \( \text{COOH} \), is a common and well-studied functional group in organic chemistry. This group undergoes deprotonation to release an \( \text{H}^+ \) ion, forming a conjugate base \( \text{RCOO}^- \). In this process:- The acidic proton attached to the hydroxyl group \( \text{-OH} \) is released.- The result is the formation of a carboxylate ion \( \text{RCOO}^- \), which is stabilized by resonance, where the negative charge can be spread out over the two oxygens of the group. Carboxylic acids are known for their relatively strong acidity compared to alcohols due to this resonance stabilization feature. In the exercise context, additional stabilization of the carboxylate ion by nearby electron-withdrawing groups further enhances the strength of the acid itself.