Problem 34
Question
Which of the following acid derivative has the least basic leaving group in a Nucleophilic substitution reaction ? (a) acid chloride (b) anhydride (c) ester (d) amide
Step-by-Step Solution
Verified Answer
Acid chloride has the least basic leaving group.
1Step 1: Understanding Acid Derivatives and Leaving Groups
In a nucleophilic substitution reaction, a leaving group's ability to leave is affected by its basicity. The weaker the base, the better the leaving group. We'll determine the basicity of the leaving groups for each given acid derivative: acid chloride, anhydride, ester, and amide.
2Step 2: Identify Leaving Groups
For each acid derivative, we determine the leaving group:
- Acid Chloride: Chloride ion (Cl⁻)
- Anhydride: Carboxylate ion (RCOO⁻)
- Ester: Alkoxide ion (RO⁻)
- Amide: Amine (NH₂⁻)
3Step 3: Evaluate Basicity of Leaving Groups
Basicity decreases as the ability to stabilize the negative charge increases. The basicity from weakest to strongest is:
- Chloride ion (Cl⁻): Weak base, good leaving group
- Carboxylate ion (RCOO⁻): Moderate base
- Alkoxide ion (RO⁻): Strong base
- Amine (NH₂⁻): Very strong base
Chloride ion (Cl⁻) is the least basic and thus the best leaving group.
4Step 4: Conclusion
Acid chloride has the least basic leaving group, the chloride ion (Cl⁻), making it the best option for nucleophilic substitution reactions among the given acid derivatives.
Key Concepts
Acid DerivativesLeaving GroupsBasicityChemical Reactions
Acid Derivatives
Acid derivatives are organic compounds that are structurally similar to acids, but have other groups replacing the hydroxyl group usually found in carboxylic acids. They play a crucial role in organic chemistry due to their reactivity in nucleophilic substitution reactions. Here are some of the most common acid derivatives:
- Acid Chlorides: In these compounds, a chlorine atom replaces the hydroxyl group. They are very reactive, making them key players in synthesis reactions.
- Anhydrides: Formed from two carboxylic acid molecules, anhydrides have two acyl groups bonded to the same oxygen atom. They are moderately reactive.
- Esters: Esters replace the hydroxyl group with an alkyl or aryl group. Their moderate reactivity makes them useful in both laboratory and industrial applications.
- Amides: Amides contain an amine group replacing the hydroxyl group. Their strong nitrogen-hydrogen bonds make them relatively less reactive.
Leaving Groups
In chemical reactions, especially in nucleophilic substitutions, the role of a leaving group is paramount. A leaving group like a passenger leaving a bus makes space for a new passenger, here in the molecular context, it's a nucleophile.
- Acid Chloride's Chloride Ion (Cl⁻): This is a highly effective leaving group due to its stability after detachment.
- Anhydride's Carboxylate Ion (RCOO⁻): Moderately effective, it can also stabilize negative charges but not as effectively as chloride.
- Ester's Alkoxide Ion (RO⁻): The alkoxide is a stronger base, making it less likely to leave.
- Amide's Amine (NH₂⁻): Being a very strong base, this group is the least likely to leave among the options.
Basicity
Basicity is the inherent characteristic of a substance (a base) to donate a pair of electrons. A key concept in evaluating basicity is the ability of a molecule or ion to stabilize its negative charge.
- Cl⁻ (Chloride Ion): This ion is a very weak base due to its large atomic radius, effectively distributing and stabilizing the negative charge.
- RCOO⁻ (Carboxylate Ion): Considered a moderate base because it can stabilize the charge on two oxygen atoms through resonance.
- RO⁻ (Alkoxide Ion): This is a strong base because of the high electronegativity and the inability of a lone oxygen atom to efficiently delocalize the negative charge.
- NH₂⁻ (Amine Ion): Being a very strong base, it combines nitrogen's electronegativity with its inability to adequately delocalize additional electron pairs.
Chemical Reactions
Chemical reactions that involve nucleophilic substitution include a substrate and a nucleophile that can eventually produce a new compound by swapping their parts. Imagine a dance of molecules, with acid derivatives taking center stage here.
- Nucleophilic Substitution Reaction: This involves a nucleophile that actively seeks out a positively charged center within a molecule, usually leading to substitution.
- Role of Acid Derivatives: These compounds differ by the ease of releasing their leaving groups, an essential character in substitution reactions.
- Reaction Dynamics: These are influenced by the nature of the group leaving. The chloride ion is awesome at leaving smoothly, enhancing the reactivity of acid chlorides.
Other exercises in this chapter
Problem 32
Which of the following is the strongest acid ? (a) O=C(O)c1ccccc1[N+](=O)[O-] (b) O=C(O)c1ccc([N+](=O)[O-])cc1 (c) O=C(O)c1cccc([N+](=O)[O-])c1 (d) O=C(O)c1cccc
View solution Problem 33
Name the product when salicylic acid is treated with acetyl chloride ? (a) salol (b) oil of wintergreen (c) aspirin (d) none of these
View solution Problem 31
Mercuric chloride is converted to mercury by the following acid (a) formic acid (b) acetic acid (c) oxalic acid (d) acetic acid
View solution