Problem 31
Question
Mercuric chloride is converted to mercury by the following acid (a) formic acid (b) acetic acid (c) oxalic acid (d) acetic acid
Step-by-Step Solution
Verified Answer
Formic acid (a) reduces mercuric chloride to mercury.
1Step 1: Identifying the Reaction
Mercuric chloride (HgCl₂) is a compound where mercury (Hg) is in a +2 oxidation state. The exercise asks which acid can reduce it to elemental mercury (Hg⁰). Reduced elements will be in a lower oxidation state than the original compound.
2Step 2: Reviewing Properties of Acids
Formic acid (HCOOH) and oxalic acid (C₂H₂O₄) are known for their reducing properties, meaning they can donate electrons to other substances. In contrast, acetic acid (CH₃COOH) is not recognized for having strong reducing capabilities.
3Step 3: Evaluating Reaction Possibilities
Among formic, acetic, and oxalic acids, formic acid and oxalic acid have the potential to reduce HgCl₂ to Hg. Specifically, these acids can donate electrons, converting the mercury ion from a +2 oxidation state to its elemental form.
4Step 4: Conclusion
Since formic acid is listed among the given options and it has known reducing capabilities, it can react with mercuric chloride to reduce it to elemental mercury, validating option (a).
Key Concepts
Mercuric Chloride ReductionFormic Acid PropertiesElemental Mercury ProductionOxidation-Reduction Reactions
Mercuric Chloride Reduction
Mercuric chloride (
HgCl₂
) is a chemical compound in which mercury exists in its +2 oxidation state. In such a form, mercury is stable and bonded with two chloride ions. However, certain chemical reactions can alter this state. The process of converting mercuric chloride to elemental mercury involves a reduction reaction. Reduction involves the gain of electrons by a substance. Therefore, to reduce
HgCl₂
to mercury (
Hg⁰
), a reducing agent that can donate electrons is necessary. Certain acids, due to their chemical properties, are effective reducing agents.
Formic Acid Properties
Formic acid (
HCOOH
) is the simplest carboxylic acid, with significant reducing capabilities. It is unique compared to other acids due to its ability to donate electrons, making it an effective reducing agent. In the presence of a substance like mercuric chloride, formic acid can actively participate in an oxidation-reduction (redox) reaction. It can reduce the mercury ions by donating electrons, transforming the mercury from its +2 oxidation state to its neutral elemental form (
Hg⁰
). Besides reducing properties, formic acid is known for being a colorless liquid with a pungent odor, often used in various industrial processes.
Elemental Mercury Production
Producing elemental mercury through chemical reactions involves reducing mercury ions from compounds like mercuric chloride. This process is highly dependent on the presence of a strong reducing agent. In this scenario, formic acid plays the role of a reductant. When it reacts with mercuric chloride, formic acid donates electrons, reducing
HgCl₂
to mercury in its pure, metallic form (
Hg⁰
). In practical applications, this ability to convert mercury ions back to elemental mercury is valuable in laboratory settings and various chemical processes.
Oxidation-Reduction Reactions
Oxidation-reduction reactions, commonly called redox reactions, are fundamental chemical processes where one substance loses electrons (oxidization), while another gains electrons (reduction). These reactions are crucial to many chemical applications, such as energy generation and metal refining. In the context of converting mercuric chloride to elemental mercury, formic acid serves as the reducing agent, facilitating the reduction of mercury ions by donating electrons. Understanding redox reactions is essential for manipulating various chemical compounds and obtaining desired substances through oxidation or reduction.
Other exercises in this chapter
Problem 26
The major product of nitration of Benzoic acid is (a) 3-Nitrobenzoic acid (b) 4-Nitrobenzoic acid (c) 2-Nitrobenzoic acid (d) 2, 4-Dinitrobenzoic acid
View solution Problem 27
Which of the following carboxylic acids undergoes decarboxylation easily? [IIT 1995] (b) \(\mathrm{C}_{6} \mathrm{H}_{5}-\mathrm{CO}-\mathrm{COOH}\) (c) CC(O)C(
View solution Problem 32
Which of the following is the strongest acid ? (a) O=C(O)c1ccccc1[N+](=O)[O-] (b) O=C(O)c1ccc([N+](=O)[O-])cc1 (c) O=C(O)c1cccc([N+](=O)[O-])c1 (d) O=C(O)c1cccc
View solution Problem 33
Name the product when salicylic acid is treated with acetyl chloride ? (a) salol (b) oil of wintergreen (c) aspirin (d) none of these
View solution