Problem 27
Question
Which of the following carboxylic acids undergoes decarboxylation easily? [IIT
1995]
(b) \(\mathrm{C}_{6} \mathrm{H}_{5}-\mathrm{CO}-\mathrm{COOH}\)
(c)
Step-by-Step Solution
Verified Answer
(b) \( \mathrm{C}_{6} \mathrm{H}_{5}-\mathrm{CO}-\mathrm{COOH} \) undergoes decarboxylation easily.
1Step 1: Identify the Structure
Examine the molecular structure of each given carboxylic acid to understand their functional groups and any substituent groups present. Specifically, identify any beta-keto group or other electron-withdrawing groups near the carboxylic acid group.
2Step 2: Analyze Decarboxylation Tendency
Decarboxylation is favored in beta-keto acids because the carbon atom adjacent to the carbonyl group stabilizes the carbanion intermediate through resonance. Hence, identify if any of the given compounds have a beta-keto acid structure, i.e., a keto group (
C=O
) on the beta carbon relative to the
COOH
group.
3Step 3: Evaluate Option (b)
Inspect the compound \( \mathrm{C}_{6} \mathrm{H}_{5}-\mathrm{CO}-\mathrm{COOH} \), which is phenyl acetic acid. This compound has a keto group (C=O) attached directly to the carboxylic acid, leading to a beta-keto acid structure where decarboxylation is more likely to occur.
4Step 4: Evaluate Option (c)
For the
CC(O)C(=O)O
structure from SMILES, there is no adjacent
C=O
to the carboxylic group that would facilitate a beta-keto decarboxylation. Hence, this is less likely to undergo decarboxylation easily.
5Step 5: Evaluate Option (d)
The compound
CC(N)C(=O)O
, with an amine group adjacent to the carboxyl group, doesn't form a beta-keto acid structure. This substantially reduces the likelihood of easy decarboxylation.
6Step 6: Conclusion
After analyzing all the compounds, identify that the compound \( \mathrm{C}_{6} \mathrm{H}_{5}-\mathrm{CO}-\mathrm{COOH} \) (option b) has the most favorable structure for decarboxylation due to its beta-keto acid structure.
Key Concepts
DecarboxylationBeta-Keto AcidsFunctional Groups
Decarboxylation
Decarboxylation is a reaction where a carboxyl group \(--COOH\) is removed from a molecule, releasing carbon dioxide \(\text{CO}_2\). This process is particularly interesting in carboxylic acids due to their potential to lose a carbon atom, simplifying the molecule. The decarboxylation process is often more facile in molecules where the carboxyl group is closely situated to a carbon that can form a stable base upon removal of the \(\text{CO}_2\).
In cases like beta-keto acids, where there is a carbonyl group (a carbon double-bonded to oxygen, \(\text{C}=\text{O}\)) next to the carboxylic group, the reaction is more favorable. The presence of the carbonyl enables the negative charge-on-the-resulting carbanion intermediate to be stabilized through resonance structures. This resonance stabilization is a key factor that makes the decarboxylation of beta-keto acids relatively easy compared to other acids without such substitution.
To determine if decarboxylation will occur, look for:
In cases like beta-keto acids, where there is a carbonyl group (a carbon double-bonded to oxygen, \(\text{C}=\text{O}\)) next to the carboxylic group, the reaction is more favorable. The presence of the carbonyl enables the negative charge-on-the-resulting carbanion intermediate to be stabilized through resonance structures. This resonance stabilization is a key factor that makes the decarboxylation of beta-keto acids relatively easy compared to other acids without such substitution.
To determine if decarboxylation will occur, look for:
- the presence of a beta-carbonyl group next to the carboxyl group
- compounds capable of forming stable products with mechanisms that stabilize intermediates during the reaction
Beta-Keto Acids
Beta-keto acids are a particular type of carboxylic acids that contain a keto group \((\text{C}=\text{O})\) on the beta-carbon relative to the carboxylate group \((\text{COOH})\). These compounds are named so because the keto group is two carbon atoms away from the carboxylic acid group, making it the beta position.
These acids play a remarkable role in organic chemistry, especially due to their propensity to undergo decarboxylation without much external encouragement. This occurs because the beta-carbonyl group facilitates enolization—an important tautomeric shift—and assists in the stabilization of the carbanion that is formed when the \(\text{CO}_2\) leaves.
For a more straightforward understanding, consider the following when identifying a beta-keto acid:
These acids play a remarkable role in organic chemistry, especially due to their propensity to undergo decarboxylation without much external encouragement. This occurs because the beta-carbonyl group facilitates enolization—an important tautomeric shift—and assists in the stabilization of the carbanion that is formed when the \(\text{CO}_2\) leaves.
For a more straightforward understanding, consider the following when identifying a beta-keto acid:
- The carbonyl (keto) group's location must be on the beta-carbon, which is two carbons away from the carboxyl group.
- Beta-keto acids readily decarboxylate because they can form cyclic intermediates that are easily resolved, freeing up \(\text{CO}_2\).
Functional Groups
Understanding functional groups is key to grasping the chemistry of carboxylic acids and their reactions. A functional group is a specific group of atoms within a molecule that is responsible for characteristic chemical reactions of that molecule. In carboxylic acids, the carboxyl group \(--COOH\) is the defining functional group, but the molecule can have others, such as carbonyl groups or amine groups.
The nature and position of these functional groups heavily influence the chemical behavior of the compound. For instance, a carbonyl group on the beta-carbon in a beta-keto acid significantly increases its reactivity due to electronic interactions and sterics that favor certain reactions such as decarboxylation.
When assessing a molecule for its chemical reactivity and properties, consider:
The nature and position of these functional groups heavily influence the chemical behavior of the compound. For instance, a carbonyl group on the beta-carbon in a beta-keto acid significantly increases its reactivity due to electronic interactions and sterics that favor certain reactions such as decarboxylation.
When assessing a molecule for its chemical reactivity and properties, consider:
- The types of functional groups present and their electronic effects.
- The relative positions of these groups to each other, which can alter the reactivity patterns.
- Possible resonance structures that may stabilize intermediates or transition states in reactions.
Other exercises in this chapter
Problem 23
When propionic acid is treated with aqueous sodium bicarbonate, \(\mathrm{CO}_{2}\) is liberated, The 'C" of \(\mathrm{CO}_{2}\) comes from (a) Methyl group (b)
View solution Problem 26
The major product of nitration of Benzoic acid is (a) 3-Nitrobenzoic acid (b) 4-Nitrobenzoic acid (c) 2-Nitrobenzoic acid (d) 2, 4-Dinitrobenzoic acid
View solution Problem 31
Mercuric chloride is converted to mercury by the following acid (a) formic acid (b) acetic acid (c) oxalic acid (d) acetic acid
View solution Problem 32
Which of the following is the strongest acid ? (a) O=C(O)c1ccccc1[N+](=O)[O-] (b) O=C(O)c1ccc([N+](=O)[O-])cc1 (c) O=C(O)c1cccc([N+](=O)[O-])c1 (d) O=C(O)c1cccc
View solution