Q3.66P

Question

Chromium(III) oxide reacts with hydrogen sulfide (H2S) gas to form chromium(III) sulfide and water: Cr2O3(s)+3H2S(g)Cr2S3(s)+3H2O(I)

To produce 421 g of Cr2S3,

(a) How many moles of Cr2O3 are required?

(b) How many grams of Xr2O3 are required?

Step-by-Step Solution

Verified
Answer

Answer

  1. The number of moles of Cr2O3 is 2.103 mol.

  2. The mass of Cr2O3 is 319.63 g.

1Step 1: Relation between mass and number of moles

The number of moles is calculated by the mass and Molar mass. The relationship between the number of moles, mass, and molar mass is given below.

Number of moles=massMolar mass

2Step 2: Calculate the number of moles of C r 2 S 3

The mass of Cr2S3 = 421 g.

The molar mass of Cr2S3 =200.19 g/mol

Thus, the number of moles of Cr2S3 is:

Number of Moles of Cr2S3=mass of Cr2S3Molar mass of Cr2S3                                                   =421g2000.19 g/mol                                                   =2.103 mol

3Step 3: Relation between the number of moles of C r 2 S 3 and C r 2 O 3

In the given reaction, 1 mol of Cr2O3 is formed from 1 mol of Cr2S3

Thus,

1 mol of Cr2O3 = 1 mol of Cr2S3

4Step 4: Calculate the number of moles of C r 2 O 3

The number of Cr2O3is:

1 mol of Cr2S3 = 1 mol of Cr2O32.103 mol of Cr2S3 = 2.103 mol of Cr2O3

Therefore, the number of moles of Cr2O3is 2.103 mol.

5Step 4: Calculate the mass of C r 2 O 3

The molar mass of Cr2O3 = 151.99 g/mol.

The mass of Cr2O3 is:

mass of Cr2O3 = moles of Cr2O3 × Molar mass of Cr2O3                             =            2.103 mol × 151.99 g/mol                             =                         319.63497 g

Therefore, the mass of Cr2O3is approximately 319.63 g.