Q3.67P

Question

Calculate the mass of each product formed when 43.82 g of diborane(B2H6)reacts with excess water:

B2H6(g)+H2O(I)H3BO3(s)+H2(s)[unbalanced]

Step-by-Step Solution

Verified
Answer

Answer

  1. The mass of H3BO3 is 195.4 g.

  2. The mass of H2 is 9.55 g.

1Step 1: Balance the chemical equation

In a balanced chemical equation, the number of atoms on the reactant side should be the same as the number of atoms on the product side for a particular atom. For balancing the reaction, the atoms are multiplied by the stochiometric coefficient.

So, the balanced chemical equation is:

B2H6(g)+6H2O(I)2H3BO3(s)+6H2(g)

2Step 2: Determine the Limiting reagent of the reaction

In the reaction, water is present in excess, so when 43.82 g of H2H6 reacts with an excess of water, B2H6 will be completely consumed in the reaction. Therefore, B2H6 is a limiting reagent.


This states that the reactant which is completely utilized in the reaction or completely used up in the reaction acts as a Limiting reagent.


3Step 3: Relation between mass and number of moles

The number of moles is calculated by the mass and Molar mass. The relationship between the number of moles, mass, and molar mass is given below.

Number of moles=massMolar mass


4Step 4: Calculate the number of moles of B 2 H 6 formed

The mass of B2H6= 43.82 g.

The molar mass of B2H6 = 27.66 g/mol.

The number of moles of B2H6is calculated as:

moles B2H6=mass of B2H6Molar mass of B2H6                    =43.82g27.66 g/mol                    =1.58 mol

Therefore, the number of moles of B2H6 formed is 1.58 mol.

5Step 5: Relation between the number of moles of B 2 H 6 and H 3 B O 3

In the given reaction, 2 mol of H3BO3 is formed from 1 mol of B2H6.

Thus,

1molofB2H6=2molofH3BO3

6Step 6: Calculate the number of moles of H 3 B O 3

The number of moles of H3BO3is:

      1 molofB2H6 = 2molofH3BO31.58 molofB2H6 = 1.58×2molofH3BO3                               =3.16molofH3BO3


7Step 7: Calculate the mass of H 3 B O 3

The molar mass of H3BO3= 61.83 g/mol.

The mass of H3BO3 is calculated as:

mass of H3BO3=moleofH3BO3×Molar mass of H3BO3                              =3.16mol×61.83 g/mol                              =195.3838g

Therefore, the mass of H3BO3is approximately195.4 g.

8Step 8: Relation between the number of moles of B 2 H 6 and H 2

In the given reaction, 6 mol of H2 is formed from 1 mol of B2H6.

Thus,

1molofB2H6=6molofH2

9Step 9: Calculate the number of moles of H 2

The number of moles of H2is:

        1 molofB2H6 = 6molof H21.58 mol of B2H6 = 1.58×6molof H2                                  =9.48molofH2


10Step 10: Calculate the mass of H 2

The molar mass of H2= 1.00784 g/mol.

The mass of H2 is calculated as:

mass of H2 = moles of H2×Molar mass of H2                       =        9.48 mol×1.00784 g/mol                       =                   9.5543232g

Therefore, the mass of H2 is approximately9.55 g.