Q3.64P

Question

Bismuth oxide reacts with carbon to form bismuth metal: Bi2O3(s)+3C(s)2Bi(s)+3CO2(g)

When 283 g of Bi2O3 reacts with excess carbon,

(a) How many moles of Bi2O3 react?

(b) How many moles of Bi form?

Step-by-Step Solution

Verified
Answer

Answer


  1. The number of moles of Bi2O3 formed is 0.607 mol.

  2. The number of moles of Bi formed is 1.214 mol.


1Step 1: Relation between mass and number of moles

The number of moles is calculated by the mass and Molar mass. The relationship between the number of moles, mass, and molar mass is given below.

Number of moles=massMolar mass

2Step 2: Conversion of mass of into moles

The mass of the Bi2O3 = 283 g

The molar mass of Bi2O3 = 465.96 g/mol

Thus, the number of moles of Bi2O3 is:

Number of moles of Bi2O3=283 g465.96 g/mol=0.60735 mol=0.607 mol

3Step 3: Determine the Limiting reagent of the reaction

In the reaction, carbon is present in excess, so when 283 g of Bi2O3 reacts with an excess of carbon, Bi2O3 will be completely consumed in the reaction. Therefore, Bi2O3 is a limiting reagent.


This states that the reactant which is completely utilized in the reaction or completely used up in the reaction acts as a Limiting reagent.

4Step 4: Calculate the number of moles of Bi formed

In the given reaction, 1mol of Bi2O3reacts with carbon and forms 2 mol of Bi.

Thus,

1 mol of Bi2O3=2 mol of Bi0.607 mol of Bi2O3=0.607×2 mol of Bi=1.214 mol of Bi

Therefore, the number of moles of Bi formed is 1.214 mol.