Problem 26
Question
Step-by-Step Solution
Verified Answer
(d) formyl cation \\(({}^{+} \mathrm{CHO})\\) is the electrophile involved.
1Step 1: Analyze the reactant
The given reactant structure is ON=CC(O)c1ccccc1. This represents a benzaldehyde derivative where an aldehyde group is attached to the benzene ring.
2Step 2: Analyze the product
The product structure is O=Cc1ccccc1O, which is a benzoic acid. This indicates that the aldehyde group has been oxidized to a carboxylic acid group.
3Step 3: Determine the electrophile as oxidizing agent
The transformation from an aldehyde to a carboxylic acid typically involves an electrophilic oxidation process. Formyl cation, which is represented by \(({}^{+} \mathrm{CHO})\), acts as an expected electrophile that facilitates the addition of an oxygen atom to the carbon center of the aldehyde group.
Key Concepts
ElectrophileOxidation ReactionAldehydeCarboxylic Acid
Electrophile
In organic chemistry, an electrophile is a chemical species that accepts an electron pair from a nucleophile to form a chemical bond. Electrophiles are often positively charged or electron-deficient molecules, making them highly reactive. They can attract electrons from other species to fill their electron vacancies. In the context of the given exercise, the formyl cation \(({}^{+} \text{CHO})\) acts as the electrophile. This means it is the species that accepts electrons during the reaction, facilitating the conversion of the aldehyde to a carboxylic acid.
- Electrophiles tend to be positive, but they can also be neutral with an electron-deficient atom.
- They play a crucial role in many organic reactions, including substitutions and additions.
- Common electrophiles include carbocations, sulfur trioxide, and carbonyl compounds.
Oxidation Reaction
Oxidation reactions in organic chemistry involve the increase of the oxygen bond count or decrease of the hydrogen bond count in a molecule. Specifically, the transformation from an aldehyde to a carboxylic acid is an oxidation reaction. During this process, the aldehyde group gains an oxygen atom, converting to a carboxylic acid group. The involved mechanism often requires an oxidizing agent.
- Oxidation can be recognized by the gain of oxygen or loss of hydrogen.
- Common oxidizing agents include potassium permanganate \( \text{KMnO}_4 \), chromium trioxide \( \text{CrO}_3 \), and oxygen itself.
- This process is crucial in biological systems and industrial applications.
Aldehyde
Aldehydes are a type of organic compound containing the carbonyl group \( \text{C=O} \) with a hydrogen atom attached to the carbon. This functionality is highly reactive and plays a crucial role in various organic reactions. In the given exercise, the starting material is a benzaldehyde, which is a specific type of aldehyde where the carbonyl group is directly attached to a benzene ring.
- The general formula for aldehydes is \( ext{RCHO}\).
- Aldehydes are typically more reactive than ketones due to lower steric hindrance.
- Common reactions involving aldehydes include oxidation to acids, reduction to alcohols, and participation in diverse condensation reactions.
Carboxylic Acid
Carboxylic acids are organic acids characterized by the presence of an -COOH group. This functional group consists of a carbonyl group bonded to a hydroxyl group. Carboxylic acids are polar and can participate in hydrogen bonding, influencing their boiling points and solubility properties. In the exercise, the conversion of an aldehyde to a carboxylic acid highlights the chemical transformation via an oxidation reaction.
- They are represented by the formula \(\text{RCOOH}\).
- Carboxylic acids are known for their acidity due to the ease with which they can donate a proton (H extsuperscript{+}).
- They are essential in biochemistry and are used in producing soaps, pharmaceuticals, and food additives.
Other exercises in this chapter
Problem 24
The treatment of bentene with isobutene in the presence of sulphuric acid gives (a) isobutyl benzene (b) tert-butyl benzene (c) \(n\)-Butyl benzene (d) no react
View solution Problem 25
Consider the following compounds: (i) ClC(Cl)(Cl)c1ccccc1 (ii) O=C(Cl)c1ccc([N+](=O)[O-])cc1(iii) Cc1ccc(C(=O)Cl)cc1 (iv) O=Cc1ccc(C(=O)Cl)cc1 the correct decre
View solution Problem 27
Phenyl magnesium bromide reacts with methanol to give (a) a mixture of anisole and \(\mathrm{Mg}(\mathrm{OH}) \mathrm{Br}\) (b) a mixture of benzene and \(\math
View solution Problem 31
CC(C)(C)C \(+\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{Cl} \frac{\text { anhydrous }}{\mathrm{AlCl}_{3}}-\mathrm{A} \stackrel{\tex
View solution