Problem 24
Question
The treatment of bentene with isobutene in the presence of sulphuric acid gives (a) isobutyl benzene (b) tert-butyl benzene (c) \(n\)-Butyl benzene (d) no reaction
Step-by-Step Solution
Verified Answer
The product is (b) tert-butyl benzene.
1Step 1: Understand the Reaction Components
Firstly, identify the components in the reaction. Benzene is the aromatic reactant, isobutene (2-methylpropene) is the alkene, and sulphuric acid is the catalyst. The role of sulphuric acid is to protonate the alkene, making it more reactive.
2Step 2: Generate the Carbocation Intermediate
Sulphuric acid will protonate isobutene to form a carbocation. The more stable teriary carbocation is formed, which is the tert-butyl cation, because it is more stable than a secondary or primary carbocation.
3Step 3: Electrophilic Aromatic Substitution
In this mechanism, the formed tert-butyl cation now acts as an electrophile, attacking the benzene ring to form a Wheland intermediate. This reaction type is electrophilic substitution, typical of aromatic compounds.
4Step 4: Restore Aromaticity
The loss of aromaticity in the intermediate is resolved by expelling a hydrogen ion from the benzene ring, restoring the stable aromatic structure. This results in the formation of tert-butyl benzene.
5Step 5: Conclude the Reaction Outcome
Given the steps and intermediates, the product of this reaction is tert-butyl benzene, due to the stable formation of the tert-butyl carbocation during the process.
Key Concepts
Aromatic CompoundsCarbocation StabilityProtonationReaction Mechanism
Aromatic Compounds
Aromatic compounds are a class of molecules characterized by their planar, cyclic structure with delocalized pi electrons. These pi electrons form a "cloud" above and below the plane of the atoms, which contributes to the molecule’s stability. A classic example of an aromatic compound is benzene, recognizable by its six-carbon ring and alternating single and double bonds.
Benzene's stability arises from its delocalized electrons, which makes it less reactive than typical alkenes. However, benzene can participate in certain reactions like electrophilic aromatic substitution due to its electron-rich nature. These reactions allow benzene to potentially form new bonds, while generally maintaining its aromatic stability.
Benzene's stability arises from its delocalized electrons, which makes it less reactive than typical alkenes. However, benzene can participate in certain reactions like electrophilic aromatic substitution due to its electron-rich nature. These reactions allow benzene to potentially form new bonds, while generally maintaining its aromatic stability.
Carbocation Stability
Carbocations are positively charged species that play a crucial role in many organic reactions. The stability of a carbocation is influenced by the degree of alkyl substitution around it. Generally, tertiary carbocations (those connected to three alkyl groups) are more stable compared to secondary or primary carbocations. This is because the alkyl groups can donate electron density, stabilizing the positive charge through hyperconjugation and inductive effects.
In the context of the reaction discussed, isobutene is protonated to form a tert-butyl carbocation. This species is particularly stable due to its tertiary nature, which makes it a very effective electrophile to participate in the subsequent steps of the reaction mechanism.
In the context of the reaction discussed, isobutene is protonated to form a tert-butyl carbocation. This species is particularly stable due to its tertiary nature, which makes it a very effective electrophile to participate in the subsequent steps of the reaction mechanism.
Protonation
Protonation is a process where a proton (H^+) is added to a molecule, increasing its positive charge. This is a crucial step in many reactions, especially those involving acids. In electrophilic aromatic substitution, protonation usually activates a substrate to become a more effective electrophile.
In our example, sulphuric acid (a strong acid) protonates isobutene, converting it into a tert-butyl carbocation. By adding a proton, the isobutene loses its double bond, forming a more reactive intermediate that can readily attack the aromatic ring of benzene.
In our example, sulphuric acid (a strong acid) protonates isobutene, converting it into a tert-butyl carbocation. By adding a proton, the isobutene loses its double bond, forming a more reactive intermediate that can readily attack the aromatic ring of benzene.
Reaction Mechanism
The reaction mechanism is the detailed sequence of steps that make up an overall chemical reaction. For electrophilic aromatic substitution, this generally involves the transformation of an electrophile and its subsequent reaction with an aromatic ring.
In the reaction between benzene and isobutene, sulphuric acid protonates isobutene to create a stable tert-butyl carbocation. This carbocation is the electrophile that attacks the electron-rich benzene ring, forming a resonance-stabilized intermediate known as the Wheland intermediate. However, this intermediate momentarily loses its aromaticity.
To restore aromaticity, a hydrogen ion (proton) is expelled from the benzene ring. This step is critical as it reforms the stable aromatic system, ultimately resulting in the formation of tert-butyl benzene, a stable product characteristic of electrophilic aromatic substitution.
In the reaction between benzene and isobutene, sulphuric acid protonates isobutene to create a stable tert-butyl carbocation. This carbocation is the electrophile that attacks the electron-rich benzene ring, forming a resonance-stabilized intermediate known as the Wheland intermediate. However, this intermediate momentarily loses its aromaticity.
To restore aromaticity, a hydrogen ion (proton) is expelled from the benzene ring. This step is critical as it reforms the stable aromatic system, ultimately resulting in the formation of tert-butyl benzene, a stable product characteristic of electrophilic aromatic substitution.
Other exercises in this chapter
Problem 22
The major product obtained on the monobromination (with \(\mathrm{Br}_{2} / \mathrm{FeBr}_{3}\) ) of the following compound ' \(\mathrm{A}\) ' is COc1cccc(C)c1
View solution Problem 23
Presence of a nitro group in a benzene ring (a) deactivates the ring towards electrophilic substitution (b) activates the ring towards clectrophilic substitutio
View solution Problem 25
Consider the following compounds: (i) ClC(Cl)(Cl)c1ccccc1 (ii) O=C(Cl)c1ccc([N+](=O)[O-])cc1(iii) Cc1ccc(C(=O)Cl)cc1 (iv) O=Cc1ccc(C(=O)Cl)cc1 the correct decre
View solution Problem 26
ON=CC(O)c1ccccc1 O=Cc1ccccc1OThe electrophile involved in the above reaction is (a) dichloromethyl cation \(\left({ }^{4} \mathrm{CHCl}_{2}\right)\) (b) dichlor
View solution