Problem 23
Question
Presence of a nitro group in a benzene ring (a) deactivates the ring towards electrophilic substitution (b) activates the ring towards clectrophilic substitution (c) renders the ring basic (d) deactivates the ring towards nucleophilic substitution
Step-by-Step Solution
Verified Answer
(a) deactivates the ring towards electrophilic substitution.
1Step 1: Understanding Electrophilic Substitution
Electrophilic substitution reactions are those where an electrophile replaces a hydrogen atom in a benzene ring. Some groups can either activate or deactivate the ring towards these reactions, affecting the reactivity of benzene.
2Step 2: Analyzing the Nitro Group
The nitro group ( ext{NO}_2) is a strong deactivating group for the benzene ring. Deactivating groups withdraw electron density from the ring through inductive and resonance effects, making the ring less reactive in electrophilic aromatic substitution reactions.
3Step 3: Determining Effect on the Ring
Since the nitro group is electron-withdrawing, it makes the benzene ring less susceptible to attack by electrophiles by stabilizing the arenium ion formed during the reaction. This deactivation applies especially to electrophiles, not nucleophiles.
4Step 4: Choosing the Correct Answer
The correct option is (a) deactivates the ring towards electrophilic substitution. The nitro group makes benzene less reactive, or 'deactivates' it, towards electrophiles in an electrophilic substitution reaction.
Key Concepts
Nitro GroupBenzene RingDeactivating Groups
Nitro Group
The nitro group, represented as \( \text{NO}_2 \), is a functional group commonly encountered in organic chemistry. It consists of one nitrogen atom bonded to two oxygen atoms, and it plays a significant role in various chemical reactions. In the context of the benzene ring, the nitro group acts as an electron-withdrawing moiety. This means it pulls electron density away from the benzene ring through resonance and inductive effects.
Due to its electron-withdrawing nature, the nitro group is classified as a deactivating group in electrophilic aromatic substitution reactions. The presence of the nitro group makes it harder for electrophiles to attack the benzene ring. This is because the nitro group reduces the overall electron density on the ring, making it less attractive to positively charged electrophiles.
It's crucial to note that the nitro group does not just influence the reactivity but also influences the orientation of the substitution. While it deactivates the ring, it also directs incoming electrophiles to the meta position relative to itself. Understanding the role and behavior of the nitro group helps chemists predict the outcome of reactions involving substituted benzene rings.
Due to its electron-withdrawing nature, the nitro group is classified as a deactivating group in electrophilic aromatic substitution reactions. The presence of the nitro group makes it harder for electrophiles to attack the benzene ring. This is because the nitro group reduces the overall electron density on the ring, making it less attractive to positively charged electrophiles.
It's crucial to note that the nitro group does not just influence the reactivity but also influences the orientation of the substitution. While it deactivates the ring, it also directs incoming electrophiles to the meta position relative to itself. Understanding the role and behavior of the nitro group helps chemists predict the outcome of reactions involving substituted benzene rings.
Benzene Ring
Benzene, with the formula \( \text{C}_6\text{H}_6 \), is a staple structure in organic chemistry known for its stability and characteristic aromaticity. The benzene ring is a six-carbon ring with alternating double bonds, often depicted as a hexagon with a circle in the middle, representing the delocalized electrons. This delocalization of electrons between the carbon atoms provides benzene with its aromatic properties, including enhanced stability and unique reactivity.
In many reactions, particularly those involving electrophilic substitution, the aromaticity of the benzene ring plays a central role. The typical reaction involves an electrophile attacking the electron-rich benzene ring, temporarily interrupting its aromaticity to form an aryl cation (also known as an arenium ion). Eventually, the aromatic character is restored in the final step of the reaction.
Benzene does not readily undergo reactions such as addition, as these would disrupt its aromatic nature. Instead, it participates in substitution reactions that preserve the stable aromatic system. Understanding these fundamental characteristics of the benzene ring helps in predicting its chemical behavior and the influence of substituent groups such as the nitro group.
In many reactions, particularly those involving electrophilic substitution, the aromaticity of the benzene ring plays a central role. The typical reaction involves an electrophile attacking the electron-rich benzene ring, temporarily interrupting its aromaticity to form an aryl cation (also known as an arenium ion). Eventually, the aromatic character is restored in the final step of the reaction.
Benzene does not readily undergo reactions such as addition, as these would disrupt its aromatic nature. Instead, it participates in substitution reactions that preserve the stable aromatic system. Understanding these fundamental characteristics of the benzene ring helps in predicting its chemical behavior and the influence of substituent groups such as the nitro group.
Deactivating Groups
Deactivating groups are substituents that, when attached to a benzene ring, diminish its reactivity towards electrophilic substitution reactions. They achieve this primarily by withdrawing electron density from the benzene ring. This withdrawal can occur through two main mechanisms: inductive effect and resonance effect.
Together, these effects result in a less reactive benzene ring, particularly less susceptible to attack by electrophiles.
Deactivating groups are the opposite of activating groups, which donate electron density to the benzene ring and enhance its ability to undergo electrophilic reactions. Knowing the effect of deactivating groups such as the nitro group is vital in synthetic organic chemistry where control over substitution patterns is required.
- Inductive Effect: This involves the pulling of electron density through sigma bonds. Electronegative atoms such as nitrogen or oxygen in a group like \( \text{NO}_2 \) withdraw electron density from the benzene ring, making it less reactive.
- Resonance Effect: This involves delocalization of electrons. For example, in the case of the nitro group, it can involve resonance structures that further delocalize electron density away from the ring.
Together, these effects result in a less reactive benzene ring, particularly less susceptible to attack by electrophiles.
Deactivating groups are the opposite of activating groups, which donate electron density to the benzene ring and enhance its ability to undergo electrophilic reactions. Knowing the effect of deactivating groups such as the nitro group is vital in synthetic organic chemistry where control over substitution patterns is required.
Other exercises in this chapter
Problem 19
Toluene by Etard's reaction gives (a) ortho-cresol (b) benzoic acid (c) benzyl alcohol (d) benzaldehyde
View solution Problem 22
The major product obtained on the monobromination (with \(\mathrm{Br}_{2} / \mathrm{FeBr}_{3}\) ) of the following compound ' \(\mathrm{A}\) ' is COc1cccc(C)c1
View solution Problem 24
The treatment of bentene with isobutene in the presence of sulphuric acid gives (a) isobutyl benzene (b) tert-butyl benzene (c) \(n\)-Butyl benzene (d) no react
View solution Problem 25
Consider the following compounds: (i) ClC(Cl)(Cl)c1ccccc1 (ii) O=C(Cl)c1ccc([N+](=O)[O-])cc1(iii) Cc1ccc(C(=O)Cl)cc1 (iv) O=Cc1ccc(C(=O)Cl)cc1 the correct decre
View solution