Problem 27
Question
Phenyl magnesium bromide reacts with methanol to give (a) a mixture of anisole and \(\mathrm{Mg}(\mathrm{OH}) \mathrm{Br}\) (b) a mixture of benzene and \(\mathrm{Mg}(\mathrm{OMe}) \mathrm{Br}\) (c) a mixture of toluene and \(\mathrm{Mg}(\mathrm{OH}) \mathrm{Br}\) (d) a mixture of phenol and \(\mathrm{Mg}(\mathrm{Me}) \mathrm{Br}\)
Step-by-Step Solution
Verified Answer
(b) a mixture of benzene and Mg(OMe)Br
1Step 1: Understand the Reactants
Phenyl magnesium bromide (C_6H_5MgBr) is a Grignard reagent and methanol (CH_3OH) is an alcohol. Grignard reagents are highly reactive towards protic molecules such as alcohols.
2Step 2: Reaction Mechanism
When phenyl magnesium bromide reacts with methanol, the acidic hydrogen from the methanol protonates the aryl group (phenyl group C_6H_5^-), producing benzene (C_6H_6). This also results in the formation of a byproduct where the magnesium coordinates with the remainder of the methanol compound, producing magnesium methoxide bromide (Mg(OMe)Br).
3Step 3: Evaluate Possible Products
The correct products are benzene and magnesium methoxide bromide, corresponding to option (b): a mixture of benzene and Mg(OMe)Br.
4Step 4: Final Answer
From the above analysis, option (b) is the correct choice for the products of the reaction between phenyl magnesium bromide and methanol.
Key Concepts
Chemical Reaction MechanismsOrganometallic ChemistryProtic Molecules in Reactions
Chemical Reaction Mechanisms
Understanding chemical reaction mechanisms is crucial for predicting and explaining the outcomes of reactions accurately. In the context of Grignard reactions, which involve organometallic compounds, the mechanism describes how a Grignard reagent such as phenyl magnesium bromide (\(\text{C}_6\text{H}_5\text{MgBr}\)) interacts with other substances like methanol (\(\text{CH}_3\text{OH}\)) to form specific products.
The mechanism of this reaction involves the transfer of a proton from the methanol to the phenyl group in the Grignard reagent. The highly electronegative oxygen in methanol attracts electrons, allowing the proton (\( ext{H}^+\)) to be transferred to the phenyl group. This results in the formation of benzene (\(\text{C}_6\text{H}_6\)), a stable aromatic compound.
Simultaneously, the magnesium bromide part of the Grignard reagent interacts with the methoxy group remaining after hydrogen transfer, forming magnesium methoxide bromide (\( ext{Mg}( ext{OMe}) ext{Br}\)). Analyzing these steps allows chemists to logically deduce the end products of such reactions.
The mechanism of this reaction involves the transfer of a proton from the methanol to the phenyl group in the Grignard reagent. The highly electronegative oxygen in methanol attracts electrons, allowing the proton (\( ext{H}^+\)) to be transferred to the phenyl group. This results in the formation of benzene (\(\text{C}_6\text{H}_6\)), a stable aromatic compound.
Simultaneously, the magnesium bromide part of the Grignard reagent interacts with the methoxy group remaining after hydrogen transfer, forming magnesium methoxide bromide (\( ext{Mg}( ext{OMe}) ext{Br}\)). Analyzing these steps allows chemists to logically deduce the end products of such reactions.
Organometallic Chemistry
Organometallic chemistry involves studying compounds that contain metal-carbon bonds, such as Grignard reagents. These reagents are invaluable in synthesis because they form carbon bonds, which are foundational in organic chemistry.
Phenyl magnesium bromide is a classic example of an organometallic compound. It consists of a magnesium atom bonded to a phenyl group and a bromine atom. In reactions, this compound acts as a nucleophile, meaning it donates an electron or pair of electrons to form a new chemical bond.
Phenyl magnesium bromide is a classic example of an organometallic compound. It consists of a magnesium atom bonded to a phenyl group and a bromine atom. In reactions, this compound acts as a nucleophile, meaning it donates an electron or pair of electrons to form a new chemical bond.
- Organometallic compounds like Grignard reagents react vigorously, often with protic molecules, to form new products.
- They are essential tools in creating carbon-carbon bonds and synthesizing a wide variety of organic molecules.
Protic Molecules in Reactions
Protic molecules, such as alcohols or water, contain hydrogen atoms that can easily participate in transfer reactions due to their acquired positive character. In chemical reactions, these molecules often donate protons (\( ext{H}^+\)) to other compounds, leading to neutralization or other changes.
In the reaction between phenyl magnesium bromide and methanol, methanol acts as a protic molecule. Its tendency to donate its acidic hydrogen is critical in the reaction mechanism. By providing a hydrogen ion, it turns the phenyl group into benzene, and simultaneously the byproduct, magnesium methoxide bromide, is formed.
This kind of proton donation is a fundamental concept in chemistry because it explains reactions' functional groups' behavior. Understanding protic interactions helps predict a reaction's path and its products, making it a pivotal topic in learning organic and organometallic chemistry.
In the reaction between phenyl magnesium bromide and methanol, methanol acts as a protic molecule. Its tendency to donate its acidic hydrogen is critical in the reaction mechanism. By providing a hydrogen ion, it turns the phenyl group into benzene, and simultaneously the byproduct, magnesium methoxide bromide, is formed.
This kind of proton donation is a fundamental concept in chemistry because it explains reactions' functional groups' behavior. Understanding protic interactions helps predict a reaction's path and its products, making it a pivotal topic in learning organic and organometallic chemistry.
Other exercises in this chapter
Problem 25
Consider the following compounds: (i) ClC(Cl)(Cl)c1ccccc1 (ii) O=C(Cl)c1ccc([N+](=O)[O-])cc1(iii) Cc1ccc(C(=O)Cl)cc1 (iv) O=Cc1ccc(C(=O)Cl)cc1 the correct decre
View solution Problem 26
ON=CC(O)c1ccccc1 O=Cc1ccccc1OThe electrophile involved in the above reaction is (a) dichloromethyl cation \(\left({ }^{4} \mathrm{CHCl}_{2}\right)\) (b) dichlor
View solution Problem 31
CC(C)(C)C \(+\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{Cl} \frac{\text { anhydrous }}{\mathrm{AlCl}_{3}}-\mathrm{A} \stackrel{\tex
View solution Problem 34
The reaction of benzene that involves a neutral electrophile is (a) bromination (b) nitration (c) sulphonation (d) gatterman koch reaction
View solution