Problem 163
Question
Identify the correct statements. (a) \(\mathrm{C}_{2} \mathrm{H}_{5}-\mathrm{O}-\mathrm{CH}_{3}\) on cleavage with \(\mathrm{PCl}_{5}\) gives equimolar mixture of ethyl chloride and methyl chloride (b) \(\mathrm{ClCH}_{2} \mathrm{CH}=\mathrm{CH}_{2}\) is more reactive than \(\mathrm{Br} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3}\) to prepare ether using Williamson's synthesis (c) Anisole can be prepared by the reaction of \(\mathrm{CH}_{3}\) ONa on chlorobenzene (d) Sodium metal can be used to dry diethyl ether, benzene and ethyl alcohol.
Step-by-Step Solution
Verified Answer
Correct statements: Only (a) is correct.
1Step 1: Analyzing Statement (a)
The compound \(\mathrm{C}_{2} \mathrm{H}_{5}-\mathrm{O}-\mathrm{CH}_{3}\) is ethyl methyl ether. When treated with \(\mathrm{PCl}_{5}\), it tends to cleave into corresponding alkyl halides. Ethyl methyl ether would form ethyl chloride \(\mathrm{C}_{2} \mathrm{H}_{5}\mathrm{Cl}\) and methyl chloride \(\mathrm{CH}_{3}\mathrm{Cl}\) in an equimolar ratio. Hence, statement (a) is correct.
2Step 2: Evaluating Statement (b)
To prepare ethers using Williamson's synthesis, the reactivity of the alkyl halide towards nucleophilic substitution is important. Alkenyl halides (with double bonds, like \(\mathrm{ClCH}_{2} \mathrm{CH} = \mathrm{CH}_{2}\)) are typically less reactive than alkyl halides (like \(\mathrm{BrCH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3}\)). Therefore, contrary to what is stated, \(\mathrm{ClCH}_{2} \mathrm{CH} = \mathrm{CH}_{2}\) is less reactive than \(\mathrm{BrCH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3}\). This makes statement (b) incorrect.
3Step 3: Checking Statement (c)
Anisole can be synthesized through Williamson's synthesis which involves \(\mathrm{CH}_{3}\)ONa reacting with \(\mathrm{C}_{6} \mathrm{H}_{5}\mathrm{Cl}\). However, chlorobenzene is generally unreactive towards \(\mathrm{CH}_{3}\)ONa due to the partial double bond character between carbon and chlorine, making nucleophilic substitution difficult. Therefore, statement (c) is incorrect.
4Step 4: Verifying Statement (d)
Sodium metal is indeed used to dry organic solvents because it reacts with water traces to form hydrogen gas. Diethyl ether and benzene can be dried using sodium metal, but since sodium reacts vigorously with ethyl alcohol forming sodium ethoxide, it is not typically used to dry alcohols. Thus, statement (d) is incorrect.
Key Concepts
SN2 reaction mechanismAlkyl halidesChemical reactions with PCl5Organic chemistry problem-solving
SN2 reaction mechanism
Understanding the SN2 reaction mechanism is key to grasping how certain chemical reactions, especially those involving Williamson's Ether Synthesis, occur. At the core of an SN2 reaction is a one-step process where bond breaking and bond forming happen simultaneously. This type of mechanism is called a 'bimolecular nucleophilic substitution' because two molecules are involved in the rate-determining step.
In an SN2 reaction, a nucleophile attacks an electrophilic carbon atom that has a good leaving group attached to it. The attack occurs from the back, which leads to an inversion of the configuration at the carbon atom, similar to flipping an umbrella on a windy day. This is why the stereochemistry of the product differs from that of the starting material.
Key characteristics of SN2 reactions include:
In an SN2 reaction, a nucleophile attacks an electrophilic carbon atom that has a good leaving group attached to it. The attack occurs from the back, which leads to an inversion of the configuration at the carbon atom, similar to flipping an umbrella on a windy day. This is why the stereochemistry of the product differs from that of the starting material.
Key characteristics of SN2 reactions include:
- Occurs in a single, concerted step.
- Involves a direct attack by the nucleophile.
- Requires a good leaving group to proceed effectively.
- Rate depends on the concentration of both the nucleophile and the substrate (rate = k[nucleophile][substrate]).
Alkyl halides
Alkyl halides are organic compounds in which one or more hydrogen atoms in an alkane are replaced by halogen atoms such as chlorine, bromine, or iodine. These compounds are essential in organic chemistry as they often serve as intermediates in the synthesis of various products, including ethers via Williamson's synthesis.
In the context of ether formation, alkyl halides play a crucial role because they act as the substrates in SN2 reactions. The nucleophile, typically an alkoxide ion, attacks the carbon atom bonded to the halogen, displacing the halogen and forming a new carbon-oxygen bond. This synthesis depends largely on the nature of the alkyl halide.
Some important features of alkyl halides include:
In the context of ether formation, alkyl halides play a crucial role because they act as the substrates in SN2 reactions. The nucleophile, typically an alkoxide ion, attacks the carbon atom bonded to the halogen, displacing the halogen and forming a new carbon-oxygen bond. This synthesis depends largely on the nature of the alkyl halide.
Some important features of alkyl halides include:
- Reactivity is affected by the nature of the halogen, with iodides generally being more reactive due to weaker carbon-halogen bonds.
- Primary alkyl halides are more reactive in SN2 reactions compared to secondary or tertiary ones due to less steric hindrance.
- Alkenyl and aryl halides are typically unreactive in SN2 mechanisms due to resonance or steric factors.
Chemical reactions with PCl5
Phosphorus pentachloride (PCl5) is a versatile reagent that is widely used in organic chemistry to convert alcohols and ethers into different products by replacing hydroxyl and ether groups with chlorine. Its role in cleaving ethers is significant because it directly influences the formation of alkyl halides.
When PCl5 is treated with an ether, it typically causes the ether to break, leading to the formation of two alkyl halides. This process is essential for situations where a controlled conversion of ethers to halides is needed.
Key aspects of PCl5 reactions include:
When PCl5 is treated with an ether, it typically causes the ether to break, leading to the formation of two alkyl halides. This process is essential for situations where a controlled conversion of ethers to halides is needed.
Key aspects of PCl5 reactions include:
- Ability to cleave ethers into corresponding alkyl halides in equimolar amounts.
- Conversion of alcohols into alkyl chlorides via a similar mechanism.
- Reactions usually proceed through the formation of a chloroalkyl intermediate.
Organic chemistry problem-solving
Organic chemistry often involves solving complex puzzles that require a deep understanding of molecular interactions and reaction mechanisms. Williamson's Ether Synthesis, reactions involving alkyl halides, and the use of reagents like PCl5 are just pieces of the larger organic chemistry puzzle.
Successfully navigating organic chemistry problems requires:
Successfully navigating organic chemistry problems requires:
- Identifying the nature of the reactants and predicting their reactivity based on structure and functional groups.
- Understanding mechanistic pathways such as SN2 or E2 to predict reaction outcomes.
- Evaluating the impact of reaction conditions, such as solvents and temperatures, on the reactions.
- Anticipating possible side reactions and considering how to mitigate them.
Other exercises in this chapter
Problem 158
Which of the following reactions will yield 2-propanol? (1) \(\mathrm{CH}_{2}=\mathrm{CH}-\mathrm{CH}_{3}+\mathrm{H}_{2} \mathrm{O} \stackrel{\mathrm{H}^{+}}{\l
View solution Problem 161
When phenol is treated with \(\mathrm{CHCl}_{3}\) and \(\mathrm{NaOH}\) followed by acidification salicylaldehyde is obtained. Which of the following species ar
View solution Problem 165
Which of the following compounds are not stea: volatile? (a) O=[N+]([O-])c1ccccc1O (b) O=[N+]([O-])c1ccc(O)cc1 (c) O=[N+]([O-])c1cc(O)cc([N+](=O)[O-])c1 (d) Cc1
View solution Problem 166
Select wrong statements: (a) Phenols turn blue litmus to red. (b) Reactivity of methanol with sodium metal is more than that of isopropyl alcohol (c) Methanol g
View solution