Problem 161
Question
When phenol is treated with \(\mathrm{CHCl}_{3}\) and \(\mathrm{NaOH}\) followed
by acidification salicylaldehyde is obtained. Which of the following species
are involved in the above reaction as intermediates?
(a)
Step-by-Step Solution
Verified Answer
The intermediate is species (b)
1Step 1: Identify the Reaction
The reaction given is the Reimer-Tiemann reaction, where phenol reacts with chloroform (\( \mathrm{CHCl}_{3} \)) in the presence of base (\( \mathrm{NaOH} \)) to form salicylaldehyde after acidification.
2Step 2: Analyze Reaction Intermediates
During the Reimer-Tiemann reaction, chloroform (\( \mathrm{CHCl}_{3} \)) reacts with the base to form the dichlorocarbene intermediate, \( :\mathrm{CCl}_2 \). This carbene then reacts with phenol.
3Step 3: Mechanism Interaction
The dichlorocarbene formed in the reaction becomes electrophilic and attacks the ortho position (relative to the OH group) of the phenolic ring, creating an intermediate complex.
4Step 4: Intermediate Verification
The intermediates being considered should include the dichlorocarbene \( :\mathrm{CCl}_2 \), but since the question provides options in SMILES format, check them against the mechanism. None of these specifically match \( :\mathrm{CCl}_2 \) related structures but (b) fits another conceivable intermediate involving phenol and dichlorocarbene.
Key Concepts
Phenol ChemistryDichlorocarbeneReaction Intermediates
Phenol Chemistry
Phenol chemistry is fascinating due to its reactive 1
o11 group, which makes phenol act as both an acid and a nucleophile.
Phenol has a hydroxyl group (1 OH1) attached directly to an aromatic benzene ring, giving it distinct chemical properties.
In reactions like the Reimer-Tiemann reaction, the phenolic 1 OH1 group remains as a major activating group, enhancing reactivity at the ortho and para positions.
When phenol undergoes substitution reactions, the lone pair of electrons on the oxygen atom participates significantly.
This is due to resonance, where the 1 OH1 group's lone pair can delocalize into the aromatic ring.
This delocalization stabilizes the reaction intermediates and favors subsequent chemical attacks.
In basic conditions, phenol can deprotonate, forming phenoxide ions (1 C_6H_5O^-1), which are even more reactive due to increased electron density.
This characteristic is exploited in processes like the Reimer-Tiemann reaction, where modified phenol interacts with different agents for targeted chemical transformations.
Phenol has a hydroxyl group (1 OH1) attached directly to an aromatic benzene ring, giving it distinct chemical properties.
In reactions like the Reimer-Tiemann reaction, the phenolic 1 OH1 group remains as a major activating group, enhancing reactivity at the ortho and para positions.
When phenol undergoes substitution reactions, the lone pair of electrons on the oxygen atom participates significantly.
This is due to resonance, where the 1 OH1 group's lone pair can delocalize into the aromatic ring.
This delocalization stabilizes the reaction intermediates and favors subsequent chemical attacks.
In basic conditions, phenol can deprotonate, forming phenoxide ions (1 C_6H_5O^-1), which are even more reactive due to increased electron density.
This characteristic is exploited in processes like the Reimer-Tiemann reaction, where modified phenol interacts with different agents for targeted chemical transformations.
Dichlorocarbene
The dichlorocarbene is an intriguing intermediate, crucial to the Reimer-Tiemann reaction.
This species is symbolized as 1:111 CCl11 _2_1.
Carbenes, in general, are neutral species containing a divalent carbon atom with two nonbonded electrons.
In the Reimer-Tiemann reaction, 1 CHCl11 _3_1 reacts under basic conditions, losing a molecule of hydrogen chloride to form the reactive 1:11 CCl11 _2_1.1
This dichlorocarbene intermediate is highly electrophilic, meaning it readily accepts electrons, allowing it to interact with the electron-rich phenolic ring.
Its formation and subsequent interactions often dictate the orientation and position of the electrophilic attack on phenol, usually targeting the ortho position near the hydroxyl group.
Understanding the dichlorocarbene's reactive nature helps clarify how selective chemical modifications occur.
In the broader context of organic chemistry, it exemplifies how small changes in molecular structure can drastically influence reaction pathways and products.
This species is symbolized as 1:111 CCl11 _2_1.
Carbenes, in general, are neutral species containing a divalent carbon atom with two nonbonded electrons.
In the Reimer-Tiemann reaction, 1 CHCl11 _3_1 reacts under basic conditions, losing a molecule of hydrogen chloride to form the reactive 1:11 CCl11 _2_1.1
This dichlorocarbene intermediate is highly electrophilic, meaning it readily accepts electrons, allowing it to interact with the electron-rich phenolic ring.
Its formation and subsequent interactions often dictate the orientation and position of the electrophilic attack on phenol, usually targeting the ortho position near the hydroxyl group.
Understanding the dichlorocarbene's reactive nature helps clarify how selective chemical modifications occur.
In the broader context of organic chemistry, it exemplifies how small changes in molecular structure can drastically influence reaction pathways and products.
Reaction Intermediates
Reaction intermediates are transient structures formed during the transformation from reactants to products in a chemical process.
They are crucial for understanding the details of complex reactions like the Reimer-Tiemann reaction.
In this scenario, several steps involve the appearance of intermediate species that are pivotal in the ultimate product formation.
Intermediates are often difficult to isolate as they are short-lived, but understanding them is essential for efficient synthesis of desired compounds.
In studying organic reactions, looking at intermediates helps chemists tweak processes to optimize yields and reduce byproducts, paving the way for more sustainable chemical processes.
They are crucial for understanding the details of complex reactions like the Reimer-Tiemann reaction.
In this scenario, several steps involve the appearance of intermediate species that are pivotal in the ultimate product formation.
- The primary and most discussed intermediate here is the dichlorocarbene (1:1 1CCl11 _2_1).
- This species interacts with phenol at specific sites due to its electrophilic nature.
- After attacking the phenol, the reaction proceeds through several stabilization steps, eventually leading to the formation of salicylaldehyde.
Intermediates are often difficult to isolate as they are short-lived, but understanding them is essential for efficient synthesis of desired compounds.
In studying organic reactions, looking at intermediates helps chemists tweak processes to optimize yields and reduce byproducts, paving the way for more sustainable chemical processes.
Other exercises in this chapter
Problem 157
Under different conditions, nitration of phenol yields 1\. o-nitrophenol 2\. p-nitrophenol 3\. \(2,4,6\)-trinitrophenol The correct sequence of decreasing order
View solution Problem 158
Which of the following reactions will yield 2-propanol? (1) \(\mathrm{CH}_{2}=\mathrm{CH}-\mathrm{CH}_{3}+\mathrm{H}_{2} \mathrm{O} \stackrel{\mathrm{H}^{+}}{\l
View solution Problem 163
Identify the correct statements. (a) \(\mathrm{C}_{2} \mathrm{H}_{5}-\mathrm{O}-\mathrm{CH}_{3}\) on cleavage with \(\mathrm{PCl}_{5}\) gives equimolar mixture
View solution Problem 165
Which of the following compounds are not stea: volatile? (a) O=[N+]([O-])c1ccccc1O (b) O=[N+]([O-])c1ccc(O)cc1 (c) O=[N+]([O-])c1cc(O)cc([N+](=O)[O-])c1 (d) Cc1
View solution