Q74P

Question

Metal hydrides react with water to form hydrogen gas and the metal hydroxide. For example, SrH2(s)+2H2O(I)Sr(OH)2(s)+2H2(g) 

You wish to calculate the mass of hydrogen gas that can be prepared from 5.70 g of SrH2 and 4.75 g of H2O 

(a) How many moles of H2 can be produced from the given mass of SrH2

(b) How many moles of H2 can be produced from the given mass of H2O 

(c) Which is the limiting reactant? 

(d) How many grams of  H2 can be produced?

Step-by-Step Solution

Verified
Answer

(a) The number of moles of H2 produced from is 0.1272 mol.

(b) The number of moles of H2 produced from is 0.0636 mol.

(c) SrH2 is the limiting reactant.

(d) The mass of H2 produced is 0.1282 g.

1Step 1: Relation between mass and number of moles

The number of moles is calculated by the mass and Molar mass. The relationship between the number of moles, mass, and molar mass is given below.

Number of moles=massMolar mass

2Step 2: Calculate the number of moles of SrH 2

The mass of SrH2  = 5.70 g.

The molar mass of SrH2 = 89.64 g/mol

Thus, the number of moles is SrH2:

Number of moles=mass SrH2Molar mass SrH2                              =5.70 g89.64 g/mol                               =0.0636mol

3Step 3: Calculate the number of moles of H 2 O

The mass of H2O  = 4.75 g.

The molar mass of H2O =18.02 g/mol

Thus, the number of moles H2O  is:

Number of moles H2O=mass H2OMolar mass H2O                              =4.75 g18.02 g/mol                               =0.2636mol

4Step 4: Determine the Limiting reagent of the reaction

In the reaction, 1 mol of SrH2  reacts with 2 mol of H2O Thus,

1mol of SrH2            =       2mol of H2O0.0636mol of SrH2  =   0.0636×2mol of H2O                                     =    0.1272mol of H2O

Therefore, H2O present in access in the reaction, hence SrH2 is a limiting reagent.

5Step 5: Calculate the number of moles of H 2 from SrH 2

In the given reaction, 1mol of SrH2 forms 2 mol of H2 

Thus, the number of moles of H2 is

1 mol of SrH2             =   2mol of H20.0636 mol of SrH2   =  0.0636 ×2mol of H2                                       =   0.1272mol of H2  

6Step 6: Calculate the number of moles of from

In the given reaction, 2mol of H2O forms 2 mol of H2

Thus, the number of moles of H2 is

2mol of H2O             =   2mol of H20.0636 mol of H2O   =  0.0636 ×22mol of H2                                       =   0.0636mol of H2

7Step 7: Calculate the mass of H 2

The molar mass of H2 =1.00784g/mol

Since the number of moles of H2 = 0.1272mol

Thus, the mass of H2 is:

 mass of H2  =    moles of H2×molar mass of H2                       =    0.1272mol×1.00784g/mol                        =    0.1282 g