Q4.96 P

Question

Predict the product(s) and write a balanced equation for each of the following redox reactions:

(a) Pentane (C5H12) + Oxygen →

(b) Phosphorus trichloride + Chlorine →

(c) Zinc + Hydrobromic acid →

(d) Aqueous Potassium iodide + Bromine →

(e) Write a balanced net ionic equation for (d).

Step-by-Step Solution

Verified
Answer

The product and the balance equation of the given reactions are:(a) C5H12(I)+8O2(g)5CO2(g)+6H2O(I)(b) PC3(I)+CI2(g)PCI5(s)(c) Zn(s)+2HBr(aq)ZnBr(aq)+H2(g)(d) 2KI(aq)+Br2(I)2KBr(aq)+I2(s)(e) 2I-(aq)+Br2(I)2Br-(aq)+I2(s)

1Step 1: Determine the product of the equation (a)

The given redox reaction is a combustion reaction.

Combustion of pentane takes place in presence of oxygen and forms carbon dioxide and water.

2Step 2: Write balanced chemical reaction of equation (a)

The balanced reaction is:

C5H12(I)+8O2(g)5CO2(g)+6H2O(I)

3Step 3: Determine the product of the equation (b)

The given redox reaction is a combination reaction.

Phosphorous trichloride combines with chlorine and forms phosphorous pentachloride.

4Step 4: Write balanced chemical reaction of equation (b)

The balanced reaction is:

PC3(I)+CI2(g)PCI5(s)

5Step 5: Determine the product of the equation (c)

The given redox reaction is a displacement reaction.

Zinc displaces two hydrogen atoms and forms zinc bromide.

6Step 6: Write balanced chemical reaction of equation (c)

The balanced reaction is:

 Zn(s)+2HBr(aq)ZnBr(aq)+H2(g)

7Step 7: Determine the product of the equation (d)

The given redox reaction is a displacement reaction.

Bromine displaces iodide from potassium iodide molecule and forms potassium bromide.

8Step 8: Write balanced chemical reaction of equation (d)

The balanced reaction is:

2KI(aq)+Br2(I)2KBr(aq)+I2(s)

9Step 9: Determine the ionic equation

The balanced equation is:

2KI(aq)+Br2(I)2KBr(aq)+I2(s)

Now, the total ionic equation is:

2K+(aq)+2I-(aq)+Br2(I)2Br-(aq)+I2(s)

10Step 10: Net ionic equation

K+ is the spectator ion in the total ionic equation and it will not be present in net ionic equation. Hence the net ionic equation is

2I-(aq)+Br2(I)2Br-(aq)+I2(s)