Q21.17P

Question

Balance the following skeleton reactions and identify the oxidizing and reducing agents:

(a) NO2(g)NO3-(aq)+NO2-(aq)[basic]

(b) Zn(s) +NO3-(aq)Zn(OH)42-(aq) +NH3(g)[basic]

(c) H2S(g)+ NO3-(aq)S8(s)+ NO(g)[acidic]

Step-by-Step Solution

Verified
Answer

(a) 2NO2( g)+2OH-NO3-(aq)+NO2-(aq)+H2O(b) 4Zn(s)+NO3-(aq)+6H2O+7OH-4Zn(OH)42-(aq)+NH3( g)(c) 24H2 S( g)+16NO3-(aq)+16H+3 S8( s)+16NO(g)+32H2O

1Definition of Oxidising Agent

In a redox chemical reaction, an oxidizing agent obtains or "accepts"/"receives" an electron from a reducing agent. In other words, any substance that oxidizes another substance is an oxidant.

2Balancing of the given reaction in part a.

(a) NO2( g)NO3-(aq)+NO2-(aq)[basic]

To balance the equation, we will follow the following steps:

1: Separate the half-reactions.

 NO2(g)NO2-(aq)NO2( g)NO3-(aq)

2: Balance all the elements other than Oxygen and Hydrogen.

NO2(g)NO2-(aq)NO2(g)NO3-(aq)

3: Now add H2O molecules to balance oxygen atoms.

NO2(g)NO2-(aq)NO2(g)+H2ONO3-(aq)


3Balancing of the given reaction in part a.

4: To balance hydrogen atoms we add protons, H+..

NO2( g)NO2-(aq)NO2( g)+H2ONO3-(aq)+2H+

5: Now balance the charge with electrons, e-..

NO2( g)+e-NO2-(aq)NO2( g)+H2ONO3-(aq)+2H++e-

6: Scale the reactions to make the electron count equal.

NO2( g)+e-NO2-(aq)NO2( g)+H2ONO3-(aq)+2H++e-

7: Add the reactions.

NO2( g)+e-+NO2( g)+H2ONO2-(aq)+NO3-(aq)+2H++e-

4Balancing of the given reaction in part a.

8: Cancel out common terms.

2NO2( g)+H2ONO2-(aq)+NO3-(aq)+2H+

9: Since, the reaction is in basic medium we add OH- to balance the H+ ions.

2NO2( g)+H2O+2OH-NO2-(aq)+NO3-(aq)+2H++2OH-

10: Combine OH- ions and H+ ions present on the same side to form water molecule.

2NO2( g)+H2O+2OH-NO2-(aq)+NO3-(aq)+2H2O

11: Cancel out common terms.

2NO2( g)+2OH-NO2-(aq)+NO3-(aq)+H2O

Hence, we get the following balanced reaction:

2NO2( g)+2OH-NO3-(aq)+NO2-(aq)+H2O

Oxidizing agent: NO2( g)

Reducing agent: NO2( g)

5Balancing of the given reaction in part b.

(b) Zn(s)+NO3-(aq)Zn(OH)42-(aq)+NH3( g)[basic]

To balance the equation, we will follow the following steps:

1: Separate the half-reactions.

NO3-(aq)NH3( g)Zn(s)Zn(OH)42-(aq)

2: Balance all the elements other than Oxygen and Hydrogen.

NO3-(aq)NH3(g)Zn(s)Zn(OH)42-(aq)

3: Now add H2O molecules to balance oxygen atoms.

NO3-(aq)NH3( g)+3H2OZn(s)+4H2OZn(OH)42-(aq)

4: To balance hydrogen atoms we add protons, H+.

NO3-(aq)+9H+NH3( g)+3H2OZn(s)+4H2OZn(OH)42-(aq)+4H+


6Balancing of the given reaction in part b.

5: Now balance the charge with electrons, e-.

NO3-(aq)+9H++8e-NH3( g)+3H2OZn(s)+4H2OZn(OH)42-(aq)+4H++2e-

6: Scale the reactions to make the electron count equal.

NO3-(aq)+9H++8e-NH3( g)+3H2O4Zn(s)+16H2O4Zn(OH)42-(aq)+16H++8e-

7: Add the reactions.

NO3-(aq)+9H++8e-+4Zn(s)+16H2ONH3( g)+3H2O+4Zn(OH)42-(aq)+16H++8e-

8: Cancel out common terms.

NO3-(aq)+4Zn(s)+13H2ONH3( g)+4Zn(OH)42-(aq)+7H+

9: Since, the reaction is in basic medium we add OH- to balance the H+ ions.

NO3-(aq)+4Zn(s)+13H2O+7OH-NH3( g)+4Zn(OH)42-(aq)+7H++7OH-


7Balancing of the given reaction in part b.

10: Combine OH- ions and H+ ions present on the same side to form water molecule.

NO3-(aq)+4Zn(s)+13H2O+7OH-NH3( g)+4Zn(OH)42-(aq)+7H2O

11: Cancel out common terms.

NO3-(aq)+4Zn(s)+6H2O+7OH-NH3( g)+4Zn(OH)42-(aq)

Hence, we get the following balanced reaction:

4Zn(s)+NO3-(aq)+6H2O+7OH-4Zn(OH)42-(aq)+NH3( g)

Oxidizing agent: NO3-(aq)

Reducing agent: Zn(s)

8Balancing of the given reaction in part c.

(c) H2 S( g)+NO3-(aq)S8( s)+NO(g)[acidic]

To balance the equation, we will follow following steps:

1: Separate the half-reactions.

NO3-(aq)NO(g)H2 S( g)S8( s)

2: Balance all the elements other than Oxygen and Hydrogen.

NO3-(aq)NO(g)8H2 S( g)S8( s)

3: Now add H2O molecules to balance oxygen atoms.

NO3-(aq)NO(g)+2H2O8H2 S( g)S8( s)

4: To balance hydrogen atoms we add protons, H+.

NO3-(aq)+4H+NO(g)+2H2O8H2 S( g)S8( s)+16H+

9Balancing of the given reaction in part c.

5: Now balance the charge with electrons, e-.

NO3-(aq)+4H++3e-NO(g)+2H2O8H2 S( g)S8( s)+16H++16e-

6: Scale the reactions to make the electron count equal.

16NO3-(aq)+64H++48e-16NO(g)+32H2O24H2S( g)3S8( s)+48H++48e-

7: Add the reactions.

16NO3-(aq)+64H++48e-+24H2 S( g)16NO(g)+32H2O+3 S8( s)+48H++48e-

                                                                           

 

10Balancing of the given reaction in part c.

8: Cancel out common terms.16NO3-(aq)+16H++24H2 S( g)16NO(g)+32H2O+3 S8( s)

Hence, we get the following balanced reaction:

24H2 S( g)+16NO3-(aq)+16H+3 S8( s)+16NO(g)+32H2O

Oxidizing agent: NO3-(aq)

Reducing agent: H2 S( g)