Q21.148CP

Question

Even though the toxicity of cadmium has become a concern, nickel-cadmium (nicad) batteries are still used commonly in many devices. The overall cell reaction is:

Cd(s)+2NiO(OH)(s)+2H2O(l)2Ni(OH)(s)+Cd(OH)2(s)

A certain nicad battery weighs  18.3g and has a capacity of 300mAh (that is, the cell can store charge equivalent to a current of  300mA flowing for 1 h). (a) What is the capacity of this cell in coulombs? (b) What mass of reactants is needed to deliver  300mAh? (c) What percentage of the cell mass consists of reactants?


Step-by-Step Solution

Verified
Answer

(a) The capacity of the cell in Columbus is obtained as: 1,080C.

(b) The mass of reactants required are obtained as: 

Cd = 0.629gNi(OH) = 1.028gH2O=0.202 gTotal=1.859 g

(c) The percentage of cell mass having the reactants is obtained as: 10.2%.

1Step 1: Define chemical reaction

Chemical synthesis or, alternatively, chemical breakdown into two or more separate chemicals occurs when one component interacts with another to generate a new material. These processes are known as chemical reactions, and they are generally irreversible until followed by other chemical reactions.

2Step 2: Evaluating the capacity

The reaction is:

Cd(s)+2NiO(OH)(s)+2H2O(l)2Ni(OH)(s)+Cd(OH)2(s)

The 300mAh capacity of the 18.3gcell implies it can operate at 300mA for an hour.

To calculate the cell's capacity, multiply the duration by the current in mA.

1hr×60min1hr×60s1min×0.300C1s=1,080C

Therefore, the capacity is: 1,080C.

3Step 3: Evaluating the mass of reactants required

The half responses are as follows:

Oxidation:CdCd2++2e-Reduction:2Ni(OH)+2H2O+2e-Ni(OH)+2OH-

Two electrons are involved in each half-reaction. To calculate the moles of electrons, divide the charge by Faraday's constant to get the mass of the reactants.

1,080C×mole-96,500C=0.0112mole-

To find the mass of each reagent, convert the moles of electron to moles of reagent and multiply by the molar masses.

The mass Cd is:

gm of Cd= 0.0112 mole-×1 molCd2 mole-×112.4 g1 molCd= 0.629

The mass NiO(OH) is:

gm of Ni(OH)=  0.0112mole-×1 molNiO(OH)1 mole-×91.70 g1 molNiO(OH)= 1.028

The mass is:

gmofH2O=  0.0112mol-×1 molH2O1mole-×18.01 g1 molH2O=  0.202 g

masstotal=  massCd+massH2O+massNiO(OH)=  0.629+1.028+0.202= 1.859 g

Therefore, the mass is:

Cd=0.629gNi(OH)=1.028gH2O=0.202 gTotal=1.859 g

4Step 4: What percentage of the cell mass consists of reactants?

Multiply the mass ratio of the reactants over the total mass by  to obtain the ratio.

1.85918.3×100 = 10.2 percent

Therefore, the cell mass contains: 10.2%.