Q21.134 CP

Question

The following reactions are used in batteries:

 I    2H2(g)+O2(g)2H2O(l)                                                          Ecell=1.23 VII   Pb(s)+PbO2(s)+2H2SO4(aq)2PbSO4(s)+2H2O(l)            Ecell=2.04 VIII  2Na(l)+FeCl2(s)2NaCl(s)+Fe(s)                                         Ecell=2.35 V

The reaction I is used in fuel cells, II in the automobile lead-acid battery, and III in an experimental high-temperature battery for powering electric vehicles. The aim is to obtain as much work as possible from a cell while keeping its weight to a minimum. (a) In each cell, find the moles of electrons transferred and G . (b) Calculate the ratio, in kJ/g, of wmax  to mass of reactants for each of the cells. Which has the highest ratio, which is the lowest, and why? (Note: For simplicity, ignore the masses of cell components that do not appear in the cell as reactants, including electrode materials, electrolytes, separators, cell casing, wiring, etc.)

Step-by-Step Solution

Verified
Answer
  1. The moles of electrons transferred and the value of  are obtained as:  I 4 electrons, ∆Go = - 474,780 JII 2 electrons,∆Go = - 393,720 JIII 2 electrons,∆Go = - 453,550 J
  2. The ratios are obtained as: I 13.2 kJ/gII - 0.61 kJ/gIII - 2.62 kJ/g . Owing to the smallest mass, reaction I have the greatest ratio, whereas reaction II has the lowest due to the big mass of reactants.
1Step 1: Define chemical reaction

Chemical synthesis or, alternatively, chemical breakdown into two or more separate chemicals occurs when one component interacts with another to generate new material. These processes are known as chemical reactions, and they are generally irreversible until followed by other chemical reactions.

2Step 2: Evaluating the moles

a.The first reaction is:

 2H2(g) + O2(g)2H2O(l)

The reactions are then divided into half.

 OHR:2H24H +  + 4e - RHR:O2 + 4e - 2 + O2 - 

Four electrons are involved in this reaction having the value as  Eocell = 1.23 V

The value of Go  then can be computed as:

 Go = - nFEocell        = - 4×96500×1.23       = - 474,780J

The second reaction is:

 Pb(s) + PbO2(s) + 2H2SO4(aq)2PbSO4(s) + 2H2O(l)

The reactions are then divided into half.

 OHR:Pb + H2SO4PbSO4 + 2e -  + 2H + RHR:PbO2 + H2SO4 + 2e -  + 2H + PbSO4 + 2H2O

Two electrons are involved in this reaction having the value as  Eocell = 2.04 V

The value of  Go then can be computed as:

 Go = - nFEocell        = - 2×96500×2.04       = - 393,720 J

The third reaction is:

 2Na(l) + FeCl2(s)2NaCl(s) + Fe(s)

The reactions are then divided into half.

 OHR:2Na2Na +  + 2e - RHR:Fe2 +  + 2e - Fe

Two electrons are involved in this reaction having the value as  Eocell = 2.35 V

The value of  Go then can be computed as:

 Go = - nFEocell          = - 2×96500×2.35          = - 453,550J

Therefore, the values are:

I 4 electrons,∆Go = - 474,780 JII 2 electrons, ∆Go = - 393,720 JIII 2 electrons,∆Go = - 453,550 J

 

3Step 3: Evaluating the ratio

b.Divide the wmax  by the total of the molar masses of all the reactants in each reaction to get the ratio.

 wmax = ∆Go

For the first reaction we obtain:

 mass = 2M MH2 + M MO2          = 21.016 g H2/mol + 32.00 g O2/mol           = 36.032

wmaxmass =  - 474,780 J36.032 g×1k J1000 J           = - 13.2 J/g


For the second reaction we obtain:

 mass = 2M MH2SO4 + M MPbO2 + MMPb        = 298.09 g H2SO4/mol + 239.20 g PbO2/mol + 207.2 g Pb/mol        = 624.58

wmaxmass =  - 393,720 J624.58 g×1k J1000 J           = - 0.61 J/g

 

For the third reaction we obtain:

 mass = 2M MNa + M MFeCl2         = 222.99 g Na/mol + 126.75 g FeCl2/mol          = 172.73

wmaxmass =  - 453,550 J172.73 g×1k J1000 J           = - 2.62 J/g

 

Due to the modest mass of its reactants, reaction I has the greatest ratio. Because of the huge mass of its reactants, Cell II has the lowest ratio.

Therefore, the values are:

 I 13.2 kJ/gII - 0.61 kJ/gIII - 2.62 kJ/g

As the reaction I has the smallest mass, it has the greatest ratio, whereas reaction II has the lowest ratio owing to the huge mass of reactants.