Q20.84 CP

Question

Among the many complex ions of cobalt are the following: 

Co(NH3)63+(aq)+3en(aq)Co(en)33+(aq)+6NH3(aq) where "en" stands for ethylenediamine, H2NCH2CH2NH2. Six CoN bonds are broken and six CoN bonds are formed in this reaction, so ΔHrxn°0; yet K>1 . What are the signs of ΔS° and ΔG°? What drives the reaction?

Step-by-Step Solution

Verified
Answer

We can estimate that based on the supplied reaction. ΔSrxn°>0  and  ΔG°<0.

Since entropy is the driving force behind the reaction TΔSrxn>>ΔHrxn

1Step 1: Definition of Delta

It is used in chemistry to indicate a change in enthalpy as well as the addition of heat to the reaction. A triangle symbol is used to represent it.

2Step 2: Calculate &#916; n r x n

Because all of the components on both sides of the reaction - reactants and products are dissolved in water, they are all present in the aqueous solution. There is no change in physical state within the response. We can compare the number of particles before and after the reaction to study the effect on the process's entropy change.

Therefore,

Δnrxn=nproducts nreactants Δnrxn=(n(Co(en)33)+n(NH3))(n(Co(NH3)63+)+n(en))Δnrxn=(1 mol+6 mol)1 mol+3 mol)Δnrxn=3 mol

The forward reaction increases the number of particles in the system by three.


3Step 3: What derives the reaction

Resulting in increased disorder and higher entropy:

ΔSrnn°>0

To estimate the sign of ΔG° , we can use the equation ΔG°=ΔHrxn°TΔSrxn°

Since ΔHrxn°0,

ΔG°=0TΔSrxn°ΔG°=TΔSrxn°

As entropy of the reaction is positive,

TΔSTxn°<0

Therefore, Gibb's Free energy would also be negative:

ΔG°<0

The reaction is driven by entropy since TΔSrxn>>ΔHrxn