Q20.63 P

Question

The U.S. government requires automobile fuels to contain a renewable component. Fermentation of glucose from corn yields ethanol, which is added to gasoline to fulfil this requirement:

 C6H12O6(s)2C2H5OH(l)+2CO2(g)

Calculate ΔH°,ΔS°, and ΔG° for the reaction at 25°C . Is the spontaneity of this reaction dependent on T? Explain

Step-by-Step Solution

Verified
Answer

The given reaction's standard free energy value is  -229.1kJ/mol. As ΔGrxn°  is negative the reaction is spontaneous.

 

1Step 1: Definition of Concept

Solubility: The maximum amount of solute that can be dissolved in the solvent at equilibrium is defined as solubility.

Constant of soluble product: For equilibrium between solids and their respective ions in a solution, the solubility product constant is defined. In general, the term "solubility product" refers to water-equilibrium insoluble or slightly soluble ionic substances.

2Step 2: Calculate ΔH ° ,ΔS ° , and ΔG °

Considering the given information:

The fermentation reaction looks like this:

 C6 H12 O6(s) 2 C2H5 OH(l)+2CO2(g)

The typical enthalpy change is,

The formation of values,  ΔHo

H2( g)=0 kJ/molO2( g)=0 kJ/molH2O(g)=-241.826 kJ/mol

The reaction's enthalpy change is calculated as follows:

 ΔHrxn°=mΔHf°P reducts) -nΔHf( reactants )°ΔHrxn°=[(2 molC2H5OH)(ΔHfo of C2H5OH)+(2 molCOCO2)(ΔHfo of CO2)]-[(1molC6H12O6)(ΔHf° of C6H12O6)]

ΔHrxn°=[(2 molC2H5OH)(-277.63 kJ/mol)+(2 molCO2)(-393.5 kJ/mol)][(1 molC6Hl2O6)(-1273.3 kJ/mol)]ΔHrxn°=-68.96 kJ=-69.0kJ

 

The change in enthalpy is negative.

As a result, the enthalpy (ΔHrxn°)changes is-69.0kJ 

Change in entropy  ΔSsystem °

Calculate the entropy change for this reaction as follows:

 DSrxn°=mSProducts °-nSreactants °

Here, m, n are moles of individual species, which are given by individual species coefficients in the balanced chemical equation.

 ΔSrxn°=[(2 molC2H5OH)(So of C2H5OH)+(2 molCOCO2)(So of CO2)]-[(1 molC6H12O6)(So of (1 molC6H12O6))]ΔSrxn°=[(2 molC2H5OH)(161 J/mol×K)+(2 molCOCO2)(213.7 J/mol×K)]-[(1 molC6H12O6)(212.1 J/mol×K)]=537.3 J/K

 ΔSrxn0=537J/K

Hence, the (ΔSrxn0 ) of the reaction is 537 J/K_  (or) 0.5373 kJ/K .

Determine the free energy change  ΔGrxno.

The standard free energy change equation is as follows:

 ΔGrxno=ΔHrxno-TΔSrxno