Q20.43 P

Question

Sulfur dioxide is released in the combustion of coal. Scrubbers use aqueous slurries of calcium hydroxide to remove the SO2 from flue gases. Write a balanced equation for this reaction and calculate ΔSo at 298 K [ Soof  CaSO3(s)=101.4J/mol K].

Step-by-Step Solution

Verified
Answer

The balanced equation is:  SO2(g)+Ca(OH)2(s)CaSO3(s)+H2O(l).

The  ΔSo is obtained as:  -160.15J/K.

1Step 1: Define Thermodynamics .

Thermodynamics is the study of the connections between heat, work, temperature, and energy. Thermodynamic principles specify how energy develops within a system and whether it is capable of having a positive impact on its surroundings.

2Step 2: Writing the balanced equation and then evaluating the .

First, construct and balance the SO2 and Ca(OH)2 reaction equation.

SO2(g)+Ca(OH)2(s)CaSO3(s)+H2O(l) 


After that, make a list of the ΔSo values for each compound.

S°SO2g=248.1J/mol KS°Ca(OH)2s=83.39J/mol KS°CaSO3s=101.4J/mol KS°H2Ol=69.94J/mol K 


Solve for the ΔSo now as:

ΔSo=npSo(product)-nrSo(reactant)......................(1)= nSoCaSO3(s)+nSo(H2O(l))-nSo(SO2(g))+nSoCa(OH)2(s)..............(2)= [1(101.4)+1(69.94)]-1(248.1)+1(83.39)J/K........................(3)ΔSo= -160.15J/K...............................................................(4) 


Therefore, the value is ΔSo= -160.15J/K .

The balanced equation is SO2(g)+Ca(OH)2(s)CaSO3(s)+H2O(l)  .