Q20.32 P

Question

For the reaction  H2O(g)+Cl2O(g)2HClO(g), you know ΔSrxno and  Soof HClO(g) and of  H2O(g). Write an expression that can be used to determine  So of Cl2O(g).

Step-by-Step Solution

Verified
Answer

The expression which will be determined is:  SoCl2O(g)=2×SoHClO(g)-SH2O(g)-ΔSrxn.

1Step 1: Entropy of a reaction.

The standard entropy of a reaction is the difference in the total standard entropy of the products and the total standard entropy of the reactants.

2Step 2: Explanation.

It is well understood that entropy is a state function (so it does not depend on the path, only on the beginning and end). As a result, the change in entropy may be estimated as follows:

 ΔSrxn=Sproducts+Sreactants


For the hypochlorous acid (HClO) production process as:

 H2O(g)+Cl2O(g)2HClO(g)ΔSorxn=2SoHClO(g)-(SoH2O(g)+SoCl2O(g))


As a result, the  SCl2O(g) may be written as:

 SoCl2O(g)=2SoHClO(g)-SoH2O(g)-ΔSorxn


Therefore, the expression is:  SoCl2O(g)=2SoHClO(g)-SoH2O(g)-ΔSorxn.