Q17.82CP

Question

Isolation of Group 8 B(10) elements, used as industrial catalysts, involves a series of steps. For nickel, the sulfide ore is roasted in air: Ni3S2(s)+O2(g)NiO(s)+SO2(g). The metal oxide is reduced by the H2 in water gas (CO+H2) to impure Ni:NiO(s)+H2(g)Ni(s)+H2O(g). The CO in water gas then reacts with the metal in the Mond process to form gaseous nickel carbonyl, Ni(s)+CO(g)Ni(CO)4(g), which is subsequently decomposed to the metal. 

(a) Balance each of the three steps, and obtain an overall balanced equation for the conversion of Ni3S2 to Ni(CO)4

(b) Show that the overall Qc is the product of the  Qc's for the individual reactions.

Step-by-Step Solution

Verified
Answer

(a) The equation is: 

 2Ni3S2s+7O2g+6H2g+24COg6NiCO4g+4SO2g+6H2Og

(b) Q0n=Qc

The reaction quotient for the overall reaction is equal to the product of the reaction quotients for the each step

1Step 1: Definition of Concept

Reactions: A balanced chemical reaction equation shows the mole relationships of reactants and products, while a chemical reaction equation gives the reactants and products. The amount of energy involved in the reaction is frequently stated. Reaction stoichiometry is the study of the quantitative aspects of chemical reactions.

2Step 2: Find the overall balanced equation

(a)

Considering the given information: 

Ni3S2s+O2gNiOs+SO2gNiOs+H2gNis+H2OgNis+COgNiCO4g

We can start by balancing the nickel and sulphur in reaction 1.

Ni3S2s+O2g3NiOs+2SO2g

After that, you must restore the oxygen balance.

Ni3S2s+72O2g3NiOs+2SO2g

To make the coefficients integer, multiply everything by two.

2Ni3S2s+7O2g6NiOs+4SO2g

Because 6NiOs is used in reaction (2), we must also react 6NiOs . Because everything appears to be in balance, we must make each coefficient 6 as well.

6NiOs+6H2g6Nis+6H2Og

Because there are 6Nis produced in reaction (3), we must react 6 moles of nickel in the following reaction.

Nis+COgNiCO4g

Make sure the rest of the elements are in order.

6Nis+24COg6NiCO4g

3Step 3: Show that the overall Q c is the product of the Q c 's for the individual reactions.

(b)

Write the overall reaction first.

2Ni3S2s+7O2g6NiOs+4SO2g6NiOs+6H2g6Nis+6H2Og6Nis+24COg6NiCO4g2Ni3S2s+7O2g+6H2g+24COg4SO2g+6NiCO4g+6H2Og

In terms of concentration, write the expression for the overall reaction's equilibrium constant.

Qc=productreactantQc=SO24NiCO46H2O6O27H26CO24

In terms of concentration, write the expression for the equilibrium constant of reaction (1).

2Ni3S2s+7O2g6Nis+4SO2gQc1=productreactantQc1=SO24O27

In terms of concentration, write the expression for the equilibrium constant of reaction (2).

6NiOs+6H2g6Nis+6H2OgQc2=productreactantQc2=H2O6H26

In terms of concentration, write the expression for the equilibrium constant of reaction (3).

6Nis+24COg6NiCO4gQc3=productreactantQc3=NiCO46CO24

Show that Qc=Qc1×Qc2×Qc3

Qc=Qc1×Qc2×Qc3SO24H2O6NiCO46O27H26CO24=SO24O27×H2O6H26×NiCO46CO24O27H26CO24=O27H26CO24

As observed, Qc=Qc1×Qc2×Qc3 .