Q156CP

Question

Aspirin (acetylsalicylic acid, C9H8O4) is made by reacting salicylic acid (C7H6O3) with acetic anhydride [(CH3CO)2O]:

C7H6O3(S)+(CH3CO)2O(I)C9H8O4(S)+CH3COOH(I)

In one reaction, 3.077 g of salicylic acid and 5.50 mL of acetic anhydride react to form 3.281 g of aspirin. (a) Which is the limiting reactant (d of acetic anhydride = 1.080 g/mL)? (b) What is the percent yield of this reaction? (c) What is the percent atom economy of this reaction?

Step-by-Step Solution

Verified
Answer
  1. The limiting reactant is Salicylic acid
  2. The percent yield of this reaction is 81.74%.
  3. The percent atom economy of this reaction is 75%.
1Step 1: Finding the limiting reactant

On multiplying the given volume to its density,

Mass of (CH3CO)2O=5.5mL(CH3CO)2O×1.080g(CH3CO)2O1mL(CH3CO)2O Mass of (CH3CO)2O=5.94gMoles of aspirin=3.077gC7H6O3×1molC7H6O3138.12gC7H6O3×1molC9H8O41molC7H6O3Moles of aspirinfromC7H6O3=0.02228molC9H8O4Moles of aspirinfrom(CH3CO)2O=5.94g(CH3CO)2O×1mol(CH3CO)2O138.12g(CH3CO)2O×1molC9H8O41mol(CH3CO)2OMoles of aspirinfrom(CH3CO)2O=0.05818molC9H8O4

The limiting reactant is salicylic acid due to their less product amount compared to acetic anhydride.

2Step 2: Finding the percent yield

To find the percent yield,

0.0228molC9H8O4×180.16gC9H8O41molC9H8O4=4.014gC9H8O4%yield=actual yieldtheoretical yield×100%yield=3.281g4.014g×100%yield=81.74%

3Step 3: Finding the percent atom economy

The percent atom economy can be derived as,

%atom economy=Number of moles×molar mass of desiredproductsum of number of moles of products×molar mass for all products×100=1mol×180.16g1molC9H8O41mol×180.16g1molC9H8O4+1mol×180.16g1molCH3COOH×100%atomeconomy=75%