Q14P

Question

Identify all nonbonding lone pairs of electrons in the following molecules, and tell what geometry you expect for each of the indicated atoms.

  1. The oxygen atom in dimethyl ether,  CH3OCH3.
  2. The nitrogen atom in trimethyl amine, N(CH3)3.
  3. The phosphorus atom in phosphine, PH3.
  4. The sulfur atom in the amino acid methionine, CH3-S-CH2-CH2-CH(NH2)-COOH .

Step-by-Step Solution

Verified
Answer
  1. 2, bent shape
  2. 1, Trigonal Pyramidal
  3. 1, Trigonal Pyramidal
  4. 2, bent shape
1Step 1: Valence Shell Electron Pair Repulsion Theory

There is a concept, called VSEPR (Valence Shell Electron Pair Repulsion) theory which is applied to predict the geometry of the molecule. The VSEPR theory is based on the fact that, there is repulsion between the pairs of valence electrons in all atoms, and the atoms will always try to arrange themselves in such a way, that there is a minimum repulsion between these electron pairs.


The total number of Valence Shell Electron Pair decides the shape of the molecule.


The number of bond pair is equal to the number of atoms linked to the central atom by single bond. 


The number of lone pairs = Total number of electron- Number of shared pair


By finding out the number of bond pairs and lone pairs around the central atom, one can predict the geometry of the molecule.

2Step 2 : Geometry of molecules

Dimethyl ether, CH3OCH3


In dimethyl ether, the oxygen atom contains 2 bond pairs (two carbon atoms bonded to it), and 2 lone (non-bonded) pairs of electrons. According to VSEPR theory, a molecule, with 2 lone pairs and 2 bond pair around the central atom, is of bent shape.


                                      


Dimethyl ether


Trimethylamine, N(CH3)3

In trimethylamine, the nitrogen atom has 3 bond pairs ( three carbon atoms bonded to it), and 1 non-bonded pair of electrons. According to VSEPR theory, molecules with 3 bond pairs and 1 non-bonded electron pair around the central atom, has trigonal pyramidal shape.

 


 Trimethylamine  



Phosphine, PH3

In phosphine, the phosphorus atom, like nitrogen atom in trimethylamine, also contains 3 bond pairs (three H atoms bonded to it), and 1 non-bonded pair of electrons. According to VSEPR theory, molecules with 3 bond pairs and 1 non-bonded electron pair around the central atom, has trigonal pyramidal shape.



                  



Phosphine



Methionine, CH3-S-CH2-CH2-CH(NH2)-COOH

In methionine, the sulfur atom (S) contains 2 bond pairs (two carbon atoms bonded to it), and 2 lone (non-bonded) pairs of electrons. According to VSEPR theory, a molecule, with 2 lone pairs and 2 bond pair around the central atom, is of bent shape.




Methionine