Q11-80E

Question

Amines are converted into alkenes by a two-step process called Hofmann elimination. SN2 reaction of the amine with an excess of CH3I in the first step yields an intermediate that undergoes Ereaction when treated with silver oxide as base. Pentylamine, for example, yields 1-pentene. Propose a structure for the intermediate, and explain why it readily undergoes elimination.


CH3CH2CH2CH2CH2NH2 2. Ag2O, H2O1. Excess CH3I CH3CH2CH2CH=CH2

Step-by-Step Solution

Verified
Answer

Structure of intermediate is:

  CH3CH2CH2CH2CH2N(CH3)+3I

Elinination is readily occurring because trimethylamine is good leaving group.

1Step 1: Hofmann elimination

Hofmann elimination reaction is for amines conversion to alkene

It is a two step process:

  • Amines when reacted with excess of methyl iodide it results in formation of quaternary ammonium iodide salt.

 

  • This salt is reacted with water and silver oxide it result in formation of quaternary ammonium hydroxide which is decomposed by heat to give less stable alkene as product which is called Hofmann product.
2Step 2: Reactions occuring

The Hofmann elimination reaction will follow two steps as discussed above: 

Reaction 1: Pentylamine reaction with excess methyl iodide will give trimetylpentyl quaternary ammonium iodide salt.

    CH3CH2CH2CH2CH2NH2 Excess CH3ICH3CH2CH2CH2CH2N+(CH3)3I

Reaction 2: Quaternary ammonium iodide salt will give alkene:

  CH3CH2CH2CH2CH2N+(CH3)3I Ag2O, H2OCH3CH2CH2CH=CH2 + :N(CH3)3 

3Step 3: Elimination reaction

Intermediate salt readily form alkene because neutral trimethylamine is good leaving group. The steric strain is relieved and the intermediate can easily abstract the more easily accessible hydrogen.