Problem 80
Question
Give structural formula for the following : (i) Phosphorous acid, \(\mathrm{H}_{3} \mathrm{PO}_{3}\) [1981 - 1 Mark] (ii) Pyrophosphoric acid, \(\mathrm{H}_{4} \mathrm{P}_{2} \mathrm{O}_{7}\) \([1981-1\) Mark \(\mid\)
Step-by-Step Solution
Verified Answer
(i) Phosphorous Acid: H-P(=O)(-OH)(-OH)
(ii) Pyrophosphoric Acid: OH-P(=O)(-OH)-O-P(=O)(-OH)-OH
1Step 1: Understanding Phosphorous Acid
Phosphorous acid is an oxyacid of phosphorus with the molecular formula \( \mathrm{H}_{3}\mathrm{PO}_{3} \). It contains one phosphorus (P) atom, three hydrogen (H) atoms, and three oxygen (O) atoms. The acid is sometimes referred to as orthophosphorous acid. It is important to understand its composition before drawing its structural formula.
2Step 2: Drawing Phosphorous Acid Structure
In \( \mathrm{H}_{3}\mathrm{PO}_{3} \), the phosphorus atom is central, bonded to three oxygen atoms and three hydrogen atoms. Two of the hydrogens are directly bonded to the phosphorus, while one hydrogen is bonded to an oxygen, forming an \( \text{-OH} \) group. Therefore, the Lewis structure can be represented as:\[ \text{H} \text{-} \text{P} \left(\text{=O}\right) \left(\text{-OH}\right) \left(\text{-OH}\right) \] where P is bonded to one oxygen with a double bond, and the others are single bonds, each with an H attached, creating two \( \text{-OH} \) groups.
3Step 3: Understanding Pyrophosphoric Acid
Pyrophosphoric acid, \( \mathrm{H}_{4}\mathrm{P}_{2}\mathrm{O}_{7} \), is formed by the combination of two phosphoric acid molecules with the removal of one water molecule. Hence, the structure consists of two phosphorus atoms sharing an oxygen bridge.
4Step 4: Drawing Pyrophosphoric Acid Structure
In \( \mathrm{H}_{4}\mathrm{P}_{2}\mathrm{O}_{7} \), each phosphorus atom is central and tetrahedrally coordinated by oxygen atoms. Between the phosphorus atoms, an oxygen atom forms a bridge. Each phosphorus is bonded to three \( \text{-OH} \) groups. The structural formula can be represented as:\[ \text{OH} \text{-} \text{P}(\text{=O})(\text{-OH})\text{-O-P}(\text{=O})(\text{-OH})\text{-OH} \] This gives a complete depiction of the molecular connections.
Key Concepts
Phosphorous AcidPyrophosphoric AcidLewis Structure
Phosphorous Acid
Phosphorous acid, chemically known as \( \mathrm{H}_{3}\mathrm{PO}_{3} \), is an oxyacid of phosphorus. It's often referred to as orthophosphorous acid. This compound consists of one phosphorus atom centrally bonded to three oxygen atoms and three hydrogen atoms. Two of these hydrogen atoms are directly connected to the phosphorus, while the third hydrogen bonds to an oxygen to form an \( \text{-OH} \) group.
This arrangement gives the molecule its Lewis structure:
This arrangement gives the molecule its Lewis structure:
- The central phosphorus atom bonds with one oxygen via a double bond.
- Each of the remaining oxygen atoms forms a single bond with phosphorus and also attaches to a hydrogen to create two \( \text{-OH} \) groups.
Pyrophosphoric Acid
Pyrophosphoric acid, with the chemical formula \( \mathrm{H}_{4}\mathrm{P}_{2}\mathrm{O}_{7} \), arises from the dehydration of two molecules of phosphoric acid. This process involves the removal of one water molecule, leading to the formation of a larger, connected structure.
The key elements to understand are:
This complete structure highlights the compound’s versatility and potential to form complex esters and salts.
The key elements to understand are:
- Two phosphorus atoms, each centrally located and tetrahedrally coordinated by oxygen atoms.
- An oxygen bridge links the two phosphorus atoms together.
- Each phosphorus atom bonds to three \( \text{-OH} \) groups.
This complete structure highlights the compound’s versatility and potential to form complex esters and salts.
Lewis Structure
The Lewis structure is a diagrammatic representation showing the arrangement of atoms and bond formation in a molecule. This model indicates how electron pairs are distributed among the atoms and helps predict molecular geometry, reactivity, and polarity.
Consider the following steps for constructing a Lewis structure:
Consider the following steps for constructing a Lewis structure:
- Sum up the valence electrons from all the atoms involved.
- Identify a central atom, usually the least electronegative one, to serve as the bonding hub.
- Arrange the other atoms around the central atom, drawing single bonds initially.
- Adjust the structure by turning single bonds into double or triple bonds, as required to satisfy the octet rule for each atom.
Other exercises in this chapter
Problem 77
Write down the resonance structures of nitrous oxide.\(O R\) Write the two resonance structures of \(\mathrm{N}_{2} \mathrm{O}\) that satisfy the octet rule.
View solution Problem 79
Give reasons for the following : (i) The experimentally determined \(\mathrm{N}-\mathrm{F}\) bond length in \(\mathrm{NF}_{3}\) is greater than the sum of the s
View solution Problem 75
Increasing order of extent of hydrolysis:\(\mathrm{CCl}_{4}, \mathrm{MgCl}_{2}, \mathrm{AlCl}_{3}, \mathrm{PCl}_{5}, \mathrm{SiCl}_{4}\)
View solution