Problem 77
Question
CCCC(CC#N)CC#N (a) 3 -methyl hexane-
\(1,2,3\)-tricarbonitrile (b) hexane-1, 2, 3 -tricarbonitrile (c)…
#
Assign the IUPAC name for the following compound.
Step-by-Step Solution
Verified Answer
The IUPAC name is 1,5,6-hexantricarbonitrile.
1Step 1: Identify the Main Carbon Chain
Observe the given SMILES string, which is N#CCCC(CC#N)CC#N. Find the longest continuous chain of carbon atoms. This chain has 6 carbon atoms.
2Step 2: Number the Carbon Chain
Start numbering the carbon chain from the end closest to an attached nitrile group (N#C). This results in C1, C2, C3, C4, C5, and C6 with a nitrile group attached to C1, C5, and C6.
3Step 3: Identify and Name Substituents
The primary substituents in this compound are the nitrile groups. The SMILES string has nitrile groups at C1, C5, and C6 of the chain.
4Step 4: Assemble the IUPAC Name
Based on the main chain and substituents identified, the compound is a hexane chain with nitrile groups at positions 1, 5, and 6. Therefore, the IUPAC name should be 1,5,6-hexantricarbonitrile.
Key Concepts
Organic ChemistrySMILES NotationNitrile GroupHexane Derivatives
Organic Chemistry
Organic chemistry is a branch of chemistry that focuses on carbon-based compounds, covering a vast range of molecules that contains carbon atoms. Carbon is unique in its ability to form four covalent bonds, which allows for complex and diverse structures. This leads to a wide variety of organic compounds, including hydrocarbons, alcohols, acids, and polymers.
Organic chemistry is essential to understanding the interactions and reactions of living systems, as many biological molecules like DNA, proteins, and carbohydrates are organic. In organic chemistry, structures are often depicted using models like Lewis structures, line diagrams, and 3D models, but accurate naming or "nomenclature" is an integral part of the subject, providing a universal language for chemists around the world.
Organic chemistry is essential to understanding the interactions and reactions of living systems, as many biological molecules like DNA, proteins, and carbohydrates are organic. In organic chemistry, structures are often depicted using models like Lewis structures, line diagrams, and 3D models, but accurate naming or "nomenclature" is an integral part of the subject, providing a universal language for chemists around the world.
SMILES Notation
SMILES (Simplified Molecular Input Line Entry System) notation is a way to represent the structure of chemical compounds using a short line of text. It's especially useful for input into chemical informatics software because it can convert structure information into a computer-readable format.
A SMILES string is linear and can portray molecules in a compact manner. Various characters represent atoms and bonds, and conventions like parentheses denote branches or cyclic compounds. For example, "CCCC" is a representation of a simple butane chain, while more complex structures, like nitriles, are indicated with symbols like "N#C" for a nitrile group. Understanding SMILES allows chemists to efficiently communicate structural details and input data into computational tools.
A SMILES string is linear and can portray molecules in a compact manner. Various characters represent atoms and bonds, and conventions like parentheses denote branches or cyclic compounds. For example, "CCCC" is a representation of a simple butane chain, while more complex structures, like nitriles, are indicated with symbols like "N#C" for a nitrile group. Understanding SMILES allows chemists to efficiently communicate structural details and input data into computational tools.
Nitrile Group
The nitrile group is a functional group in organic chemistry characterized by a carbon atom triple-bonded to a nitrogen atom, denoted as \(\text{C}\equiv\text{N}\). This functional group is versatile and found in many organic compounds.
Nitrile groups are reactive and can undergo various chemical transformations, making them useful in synthetic organic chemistry for the formation of other functional groups. In IUPAC naming, the presence of a nitrile group is often denoted by the suffix "-nitrile." Nitriles are significant in numerous industrial applications, including the manufacture of pharmaceuticals, plastics, and dyes. The high polarity of the \(\text{C}\equiv\text{N}\) bond also affects the physical properties of nitrile-containing compounds, causing higher boiling points compared to non-polar alkane counterparts.
Nitrile groups are reactive and can undergo various chemical transformations, making them useful in synthetic organic chemistry for the formation of other functional groups. In IUPAC naming, the presence of a nitrile group is often denoted by the suffix "-nitrile." Nitriles are significant in numerous industrial applications, including the manufacture of pharmaceuticals, plastics, and dyes. The high polarity of the \(\text{C}\equiv\text{N}\) bond also affects the physical properties of nitrile-containing compounds, causing higher boiling points compared to non-polar alkane counterparts.
Hexane Derivatives
Hexane derivatives refer to chemical compounds that are based on the hexane molecule, which consists of a straight or branched chain of six carbon atoms. In derivatives, one or more hydrogen atoms from hexane are replaced with other atoms or groups, altering the compound's properties and reactivity.
For instance, in the provided compound, nitrile groups have been added to the hexane chain, significantly changing its chemical behavior. Because hexane itself is a non-polar hydrocarbon, the introduction of polar groups like nitriles makes the compound more reactive and soluble in polar solvents.
Naming these derivatives according to IUPAC nomenclature often involves using locants to indicate the position of the substituted groups on the parent chain, as shown in the exercise where nitrile groups appear at specific positions, resulting in names like "1,5,6-hexantricarbonitrile." This precise naming helps in identifying the structural variations and properties of hexane derivatives.
For instance, in the provided compound, nitrile groups have been added to the hexane chain, significantly changing its chemical behavior. Because hexane itself is a non-polar hydrocarbon, the introduction of polar groups like nitriles makes the compound more reactive and soluble in polar solvents.
Naming these derivatives according to IUPAC nomenclature often involves using locants to indicate the position of the substituted groups on the parent chain, as shown in the exercise where nitrile groups appear at specific positions, resulting in names like "1,5,6-hexantricarbonitrile." This precise naming helps in identifying the structural variations and properties of hexane derivatives.
Other exercises in this chapter
Problem 75
Assign the IUPAC name for the following compound. Clc1ccc(N=Nc2cccc(Cl)c2)cc1 (a) 3,4 -dichloroazobenzene (b) (4-chlorophenyl) (3-chlorophenyl) diazene (c) 3,4
View solution Problem 76
Write the IUPAC name of the following compound. CCOC(=O)c1ccccc1C(=O)Cl (a) ethyl-2-(chlorocarbonyl) benzoate (b) ethyl-2-(chlorocarbonyl) hexanoate (c) 2-(etho
View solution Problem 79
The number of chiral carbon atoms in the given compound is are CCC1CCCCC1Br (a) 2 (b) 3 (c) 4 (d) 1
View solution Problem 80
A compound with molecular formula \(\mathrm{C}_{7} \mathrm{H}_{16}\) shows optical isomerism. The compound will be (a) 2-methylhexane (b) 2,2 -dimethylpentane (
View solution