Problem 7
Question
The alkyl halide is converted into an alcohol by (a) substitution (b) addition (c) elimination (d) dehydrohalogenation
Step-by-Step Solution
Verified Answer
(a) substitution
1Step 1: Understanding Alkyl Halide Reaction
Alkyl halides can undergo different reactions depending on the conditions. In this context, to convert an alkyl halide into an alcohol, we are looking at typical reaction mechanisms involving substitution of the halide group with a hydroxyl group.
2Step 2: Defining Substitution
Substitution reactions involve the replacement of one functional group in a molecule with another. For alkyl halides, a common substitution reaction is the nucleophilic substitution where the halogen atom is replaced by a nucleophile, such as the hydroxyl ion (\( OH^- \)), to form an alcohol.
3Step 3: Considering Addition Reactions
Addition reactions usually involve compounds with multiple bonds (like alkenes or alkynes) where atoms are added to the starting material. Alkyl halides typically do not undergo addition reactions to form alcohols.
4Step 4: Eliminating Elimination Reactions
Elimination reactions involve the removal of atoms or groups from adjacent carbon atoms, leading to the formation of a new double bond, such as in an alkene. This process is not used to convert alkyl halides to alcohols.
5Step 5: Reviewing Dehydrohalogenation
Dehydrohalogenation is a type of elimination reaction where a hydrogen and a halogen are removed from a molecule to form an alkene. This does not result in the formation of an alcohol from an alkyl halide.
Key Concepts
Nucleophilic SubstitutionAlkyl HalidesAlcohol Formation
Nucleophilic Substitution
A nucleophilic substitution is a type of chemical reaction where a nucleophile, a molecule or ion with a pair of electrons, replaces another group in a compound. In the context of alkyl halides, which contain carbon-halogen bonds, nucleophilic substitution is a key mechanism.
The halogen atom in alkyl halides is relatively more electronegative than carbon, making the carbon atom electrophilic, or electron-loving. This allows for a nucleophile, such as the hydroxyl ion (\( OH^- \)), to attack and form a new bond with the carbon atom, substituting the halogen atom.
The halogen atom in alkyl halides is relatively more electronegative than carbon, making the carbon atom electrophilic, or electron-loving. This allows for a nucleophile, such as the hydroxyl ion (\( OH^- \)), to attack and form a new bond with the carbon atom, substituting the halogen atom.
- A nucleophile is any chemical species that donates an electron pair to form a chemical bond.
- The process involves breaking the bond between the carbon and the halogen, while forming a bond between the carbon and the nucleophile.
- Nucleophilic substitutions are significant because they allow the conversion of alkyl halides into alcohols.
Alkyl Halides
Alkyl halides are compounds containing one or more halogen atoms attached to an alkyl group. These molecules are significant in organic chemistry because they act as starting points for a multitude of chemical transformations.
Alkyl halides have a general formula of \( R-X \), where \( R \) represents an alkyl group and \( X \) is a halogen (like chlorine, bromine, or iodine). The carbon-halogen bond is polar because of the halogen's greater electronegativity, making alkyl halides reactive in substitution reactions.
Alkyl halides have a general formula of \( R-X \), where \( R \) represents an alkyl group and \( X \) is a halogen (like chlorine, bromine, or iodine). The carbon-halogen bond is polar because of the halogen's greater electronegativity, making alkyl halides reactive in substitution reactions.
- They are often used in reactions as intermediates to form alcohols and other products.
- The reactivity can vary depending on the halogen present, with iodine generally being more reactive than bromine or chlorine due to weaker bond strength.
- Alkyl halides can be primary, secondary, or tertiary, influencing the path of the chemical reactions they undergo, such as SN1 or SN2 mechanisms in nucleophilic substitution.
Alcohol Formation
The formation of alcohols from alkyl halides is primarily done through nucleophilic substitution reactions. This transformation is one of the critical ways to introduce a hydroxyl group into organic compounds, resulting in alcohols.
During this process, alkyl halides are treated with a suitable nucleophile like hydroxide ions (\( OH^- \)), which replaces the halogen in the alkyl halide molecule. This leads to the production of an alcohol, which is characterized by an \( -OH \) group.
During this process, alkyl halides are treated with a suitable nucleophile like hydroxide ions (\( OH^- \)), which replaces the halogen in the alkyl halide molecule. This leads to the production of an alcohol, which is characterized by an \( -OH \) group.
- The reaction is highly useful in converting readily available alkyl halides into various alcohols, which can serve as fuels, solvents, and starting materials for pharmaceuticals.
- The choice of solvent, temperature, and specific reagents can affect the efficiency and yield of the alcohol formed.
- Understanding the underlying mechanism of this reaction is important for optimizing conditions in industrial and laboratory settings.
Other exercises in this chapter
Problem 4
The starting substance for the preparation of iodoform is any one of the following, except (a) \(\mathrm{CH}_{3} \mathrm{CH}(\mathrm{OH}) \mathrm{CH}_{3}\) (b)
View solution Problem 5
The following structural formula refers to Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1 (a) DDT (b) RNA (c) DNA (d) \(\mathrm{BHC}\)
View solution Problem 8
Which of the following alkyl halides is used as a methylating agent? (a) \(\mathrm{C}_{s} \mathrm{H}_{5} \mathrm{Cl}\) (b) \(\mathrm{C}_{2} \mathrm{H}_{3} \math
View solution Problem 9
Of the following compounds, the one with the lowest boiling point is? (a) pentyl chloride (b) tertiary butyl chloride (c) isobutyl chloride (d) n-butyl chloride
View solution