Problem 60 - A Complete Resource Book in Chemistry for JEE Main

Question

2 -methylpenta- 2,3 -diene is achiral as it has (a) a centre of symmetry (b) a plane of symmetry (c) a \(\mathrm{C}_{2}\) axis of symmetry (d) both centre and a plane of symmetry

Step-by-Step Solution

Answer

2-methylpenta-2,3-diene is achiral and does not have any identified symmetries.

Step 1: Analyze Molecular Structure

The structure of 2-methylpenta-2,3-diene can be visualized as CH3-C(=C-CH3)-CH2-CH=CH2. To determine chirality or achirality, we need to check whether this molecule has a plane of symmetry or a center of symmetry.

Step 2: Identify Plane of Symmetry

A plane of symmetry divides the molecule into two mirror-image halves. Upon visualizing the structure of 2-methylpenta-2,3-diene, it is evident that there is no such plane that can divide the molecule into two identical halves.

Step 3: Identify Center of Symmetry

A center of symmetry means that for any atom in the molecule, an identical atom should be positioned diametrically opposite from the center. This structure lacks a center of symmetry because the spatial arrangement does not allow opposite pairs for all atoms.

Step 4: Check for 2 Axis of Symmetry

A 2 axis of symmetry means the molecule can be rotated 180° around an axis and appear identical. The structure of 2-methylpenta-2,3-diene does not satisfy this condition either due to its uneven distribution of groups.

Key Concepts

Symmetry in Organic Chemistry

In organic chemistry, symmetry plays a crucial role in determining the chirality and overall geometry of molecules. Chirality refers to a molecule's ability to exist in non-superimposable mirror image forms, known as enantiomers. Symmetrical molecules can display identical behavior under certain transformations, impacting their physical and chemical properties.

There are several symmetry elements:

• A plane of symmetry divides a molecule into two identical halves.
• A center of symmetry ensures that identical atoms or groups are present on opposite ends of the molecule.
• An axis of symmetry allows for rotation around an axis, resulting in a molecule that looks the same after a certain degree of rotation.

Understanding these concepts aids in analyzing whether a molecule is chiral, therefore possessing unique characteristics based on its asymmetry.

Plane of Symmetry

A plane of symmetry is a critical feature in assessing molecular chirality. When present, it divides the molecule into two mirror-image halves, leading to an achiral nature since the mirror halves overlap perfectly.

To visualize a plane of symmetry, imagine a flat, 2-dimensional surface slicing through the molecule. If each atom on one side of the plane has a mirror image on the opposite side, the molecule exhibits a plane of symmetry.

In the structure of 2-methylpenta-2,3-diene, a plane of symmetry does not exist. This absence of a dividing plane prevents the molecule from having both halves symmetrical.

Center of Symmetry

The center of symmetry in a molecule implies that for any point in the molecule, there is an identical component equidistant in the opposite direction from a central point. It gives the molecule a balanced, uniform appearance.

Molecules with a center of symmetry are generally achiral, as they do not have the characteristic asymmetry needed for chirality. To determine if a molecule has this trait, visualize a central point and ensure every atom or group has an equivalent counterpart directly opposite it.

For 2-methylpenta-2,3-diene, a center of symmetry is absent. The spatial arrangement and structure do not support a symmetric organization around a central point.

C2 Axis of Symmetry

An axis of symmetry means rotating the molecule around this axis reproduces the molecule's original appearance, specifically by a certain degree. The C2 axis of symmetry involves rotation by 180 degrees, or half-turn, around the axis.

It is essential for assessing molecular symmetry and identifying if a molecule can be considered achiral. To locate a C2 axis, one should look for an imaginary line that the molecule could be rotated around, resulting in the same visual structure.

In 2-methylpenta-2,3-diene, a C2 axis is not present. Its uneven distribution of atoms and substituents makes it impossible for the structure to appear unaltered after a 180-degree rotation.