Problem 60

Question

2 -methylpenta- 2,3 -diene is achiral as it has (a) a centre of symmetry (b) a plane of symmetry (c) a \(\mathrm{C}_{2}\) axis of symmetry (d) both centre and a plane of symmetry

Step-by-Step Solution

Verified
Answer
2-methylpenta-2,3-diene is achiral and does not have any identified symmetries.
1Step 1: Analyze Molecular Structure
The structure of 2-methylpenta-2,3-diene can be visualized as CH3-C(=C-CH3)-CH2-CH=CH2. To determine chirality or achirality, we need to check whether this molecule has a plane of symmetry or a center of symmetry.
2Step 2: Identify Plane of Symmetry
A plane of symmetry divides the molecule into two mirror-image halves. Upon visualizing the structure of 2-methylpenta-2,3-diene, it is evident that there is no such plane that can divide the molecule into two identical halves.
3Step 3: Identify Center of Symmetry
A center of symmetry means that for any atom in the molecule, an identical atom should be positioned diametrically opposite from the center. This structure lacks a center of symmetry because the spatial arrangement does not allow opposite pairs for all atoms.
4Step 4: Check for 2 Axis of Symmetry
A 2 axis of symmetry means the molecule can be rotated 180° around an axis and appear identical. The structure of 2-methylpenta-2,3-diene does not satisfy this condition either due to its uneven distribution of groups.

Key Concepts

Symmetry in Organic ChemistryPlane of SymmetryCenter of SymmetryC2 Axis of Symmetry
Symmetry in Organic Chemistry
In organic chemistry, symmetry plays a crucial role in determining the chirality and overall geometry of molecules. Chirality refers to a molecule's ability to exist in non-superimposable mirror image forms, known as enantiomers. Symmetrical molecules can display identical behavior under certain transformations, impacting their physical and chemical properties.

There are several symmetry elements:
  • A plane of symmetry divides a molecule into two identical halves.
  • A center of symmetry ensures that identical atoms or groups are present on opposite ends of the molecule.
  • An axis of symmetry allows for rotation around an axis, resulting in a molecule that looks the same after a certain degree of rotation.
Understanding these concepts aids in analyzing whether a molecule is chiral, therefore possessing unique characteristics based on its asymmetry.
Plane of Symmetry
A plane of symmetry is a critical feature in assessing molecular chirality. When present, it divides the molecule into two mirror-image halves, leading to an achiral nature since the mirror halves overlap perfectly.

To visualize a plane of symmetry, imagine a flat, 2-dimensional surface slicing through the molecule. If each atom on one side of the plane has a mirror image on the opposite side, the molecule exhibits a plane of symmetry.

In the structure of 2-methylpenta-2,3-diene, a plane of symmetry does not exist. This absence of a dividing plane prevents the molecule from having both halves symmetrical.
Center of Symmetry
The center of symmetry in a molecule implies that for any point in the molecule, there is an identical component equidistant in the opposite direction from a central point. It gives the molecule a balanced, uniform appearance.

Molecules with a center of symmetry are generally achiral, as they do not have the characteristic asymmetry needed for chirality. To determine if a molecule has this trait, visualize a central point and ensure every atom or group has an equivalent counterpart directly opposite it.

For 2-methylpenta-2,3-diene, a center of symmetry is absent. The spatial arrangement and structure do not support a symmetric organization around a central point.
C2 Axis of Symmetry
An axis of symmetry means rotating the molecule around this axis reproduces the molecule's original appearance, specifically by a certain degree. The C2 axis of symmetry involves rotation by 180 degrees, or half-turn, around the axis.

It is essential for assessing molecular symmetry and identifying if a molecule can be considered achiral. To locate a C2 axis, one should look for an imaginary line that the molecule could be rotated around, resulting in the same visual structure.

In 2-methylpenta-2,3-diene, a C2 axis is not present. Its uneven distribution of atoms and substituents makes it impossible for the structure to appear unaltered after a 180-degree rotation.