Problem 56

Question

Write the condensed structural formula for each of the following compounds: (a) 2 -ethyl-1-hexanol, (b) methyl phenyl ketone, (c) para-bromobenzoic acid, (d) butyl ethyl ether, \((\mathbf{e}) N, N\) -dimethylbenzamide.

Step-by-Step Solution

Verified
Answer
(a) CH3CH(CH2CH3)CH2CH2CH2CH2OH, (b) C6H5COCH3, (c) BrC6H4COOH, (d) C2H5OC4H9, (e) C6H5C(O)N(CH3)2.
1Step 1: Analyze 2-ethyl-1-hexanol
Let's break down the name **2-ethyl-1-hexanol**. The main chain is hexanol, which means it has six carbon atoms ( C6) and an alcohol group (-OH) at the first carbon. The ethyl group (CH3CH2) is attached to the second carbon. The structure can be written as: CH3CH(CH2CH3)CH2CH2CH2CH2OH.
2Step 2: Consider methyl phenyl ketone
**Methyl phenyl ketone** consists of a phenyl group (C6H5-) directly attached to the carbon of the ketone group, with a methyl group (CH3) on the other side of the ketone carbon. This can be represented as: C6H5COCH3.
3Step 3: Assess para-bromobenzoic acid
For **para-bromobenzoic acid**, start with benzoic acid (a benzene ring with a carboxylic acid group, COOH). The para position indicates that the bromine atom is located opposite the carboxylic acid on the benzene ring. The structural formula is: BrC6H4COOH.
4Step 4: Examine butyl ethyl ether
**Butyl ethyl ether** consists of two alkyl groups, butyl (C4H9) and ethyl (C2H5), connected by an oxygen atom. The condensed structural formula is: C2H5OC4H9.
5Step 5: Unravel N,N-dimethylbenzamide
For **N,N-dimethylbenzamide**, begin with benzamide (a benzene ring with an amide group, C(O)NH2). Here, both hydrogens on the nitrogen are replaced by methyl groups, so the structure becomes: C6H5C(O)N(CH3)2.

Key Concepts

Organic CompoundsNomenclatureStructural AnalysisFunctional Groups
Organic Compounds
Organic compounds are a large class of chemical compounds whose molecules contain carbon. These compounds form the basis of all living things, making them fundamental to life itself. Carbon's unique ability to form stable bonds with other carbon atoms allows for the formation of complex molecules with chains and rings as fundamental structures. Additionally, carbon can form stable covalent bonds with a variety of other elements such as hydrogen, oxygen, nitrogen, and halogens. This contributes to the vast diversity and complexity of organic compounds.

Some common types of organic compounds include hydrocarbons (composed only of carbon and hydrogen), alcohols (characterized by hydroxyl groups, -OH), ketones (featuring carbonyl groups, RC(=O)R'), and ethers (where an oxygen atom connects two alkyl or aryl groups). Understanding the structure and function of organic compounds is essential for disciplines such as biochemistry, medicine, and materials science. In this exercise, we deal with different types of organic compounds, each with unique structures and properties derived from their functional groups and connectivity.
Nomenclature
Nomenclature in chemistry is the system of naming chemical compounds to ensure clear communication. In the Organic Chemistry realm, several rules from the International Union of Pure and Applied Chemistry (IUPAC) provide standardized methods for naming. The rules consider the longest carbon chain, the functional groups present, and the positions of these groups on the carbon chain.

For example:
  • In "2-ethyl-1-hexanol", "hexanol" refers to a six-carbon alcohol chain with an -OH group. "2-ethyl" indicates an ethyl group attached to the second carbon of the main chain.
  • "Methyl phenyl ketone" indicates a structure where a methyl group and a phenyl group (a benzene ring) are attached to a ketone group (CO).
  • When "para-bromobenzoic acid" is named, "para" signifies the relative position of the bromine and the carboxylic acid on a benzene ring, indicating that they are opposite each other on the ring.
Nomenclature helps make the study of chemistry standardized and enables chemists to infer a compound's structure merely by its name.
Structural Analysis
Structural analysis in organic chemistry involves understanding the arrangement of atoms within a molecule. This can be represented using structural formulas, which visually depict the connectivity between atoms. As such, structural formulas are key in understanding how molecules interact, their reactivity, and properties.
In condensed structural formulas, atoms and their bonds are shown in a linear format, simplifying the depiction. For example:

  • In "2-ethyl-1-hexanol", its condensed form is written as CH3CH(CH2CH3)CH2CH2CH2CH2OH, showing the main chain and branching clearly.
  • For "methyl phenyl ketone", the formula C6H5COCH3 illustrates the phenyl group (C6H5), ketone (CO), and methyl group (CH3) linearly.
  • In "para-bromobenzoic acid", BrC6H4COOH, the position of these groups in relation to each other on the benzene ring is crucial for its properties.

Understanding structural analysis allows chemists to design and synthesize new compounds with targeted properties.
Functional Groups
Functional groups are specific groups of atoms within molecules that are responsible for the characteristic chemical reactions of those molecules. Recognizing these groups is essential for predicting how organic compounds will react under various conditions.

Here are a few examples from the exercises:
  • In "hexanol", the -OH group is characteristic of alcohols, influencing solubility and reactivity.
  • Methyl phenyl ketone features a keto group, which is known for its role in carbonyl chemistry, making it quite reactive.
  • Para-bromobenzoic acid contains both a carboxylic acid group (-COOH) and a bromine atom, contributing to acid-base reactions and halogenation processes.
  • In "butyl ethyl ether", the ether group (R-O-R') connects two carbon chains, imparting unique solubility and volatility characteristics to the molecule.
  • "N,N-Dimethylbenzamide" has an amide functional group where the attached methyl groups affect the electron density and reactivity of the original amide.
Functional groups play a pivotal role in classifying organic compounds and understanding their behavior in chemical reactions.