Problem 53 - Chemistry: The Central Science

Question

Draw the structure for 2-bromo-2-chloro-3-methylpentane, and indicate any chiral carbons in the molecule.

Step-by-Step Solution

Answer

The structure of 2-bromo-2-chloro-3-methylpentane is C1-*C2(Br)(Cl)-C3(CH3)-C4-C5, where C2 is a chiral carbon indicated by an asterisk (*). C2 is chiral because it has four different substituents: C1, C3, a bromine atom, and a chlorine atom.

Step 1: Draw the parent chain

Draw a straight chain of 5 carbons. This represents the "pentane" part of the compound. Label each carbon as C1, C2, C3, C4, and C5 from left to right.

Step 2: Add substituents

On C2, add a bromine (Br) atom and a chlorine (Cl) atom. On C3, add a methyl (CH3) group. So, the molecule will look like this: C1-C2(Br)(Cl)-C3(CH3)-C4-C5

Step 3: Search for chiral carbons

A chiral carbon must have four different substituents. Let's examine each carbon: 1. C1 has two hydrogen atoms and is bonded to C2, so it's not chiral. 2. C2 is bonded to C1, C3, a bromine atom, and a chlorine atom. It has four different substituents, so it's a chiral carbon. 3. C3 is bonded to C2, C4, a hydrogen atom, and a methyl group. It has only three different substituents, so it's not chiral. 4. C4 has two hydrogen atoms and is bonded to C3 and C5, so it's not chiral. 5. C5 has three hydrogen atoms and is bonded to C4, so it's not chiral. So, only C2 is a chiral carbon in this molecule.

Step 4: Indicate the chiral carbon

To indicate this chiral carbon, mark C2 with an asterisk (*). This is a common symbol used to show chiral carbons. The final structure will look like this: C1-*C2(Br)(Cl)-C3(CH3)-C4-C5 This is the structure of 2-bromo-2-chloro-3-methylpentane with the chiral carbon (C2) indicated.

Key Concepts

Chiral Carbons

In organic chemistry, chiral carbons play a significant role in determining the molecule's properties and behavior. A chiral carbon atom is one that is attached to four different groups or atoms. This unique configuration allows for molecules to have non-superimposable mirror images, much like left and right hands. These mirror images are known as enantiomers. Understanding chiral carbons is vital because enantiomers can have vastly different effects in biological systems. For example, while one enantiomer of a drug might be therapeutic, its counterpart could be harmful.

When examining a molecule for chiral carbons, look for carbon atoms bonded to four distinct groups. Using the molecule 2-bromo-2-chloro-3-methylpentane as an example, C2 is a chiral carbon because it connects to four different entities: a bromine, a chlorine, a methyl group, and a carbon chain part. This configuration distinguishes it as a center of chirality, which has many implications in stereochemistry and chemical reactions.

Molecular Structure

The molecular structure of a compound provides a blueprint of how the atoms are arranged and connected in a molecule. This is crucial in understanding not just the chemical formula, but also the shape, reactivity, and interaction of the molecule with others. In the case of 2-bromo-2-chloro-3-methylpentane, the molecular structure starts with its parent chain of pentane, consisting of five carbon atoms linked linearly.

The substituents, namely bromine, chlorine, and a methyl group, are attached to specific positions on the carbon chain, drastically modifying its characteristics. The two halogens (bromine and chlorine) are attached to the second carbon, while the methyl group finds its place on the third carbon. This addition of various substituents leads to a branching in the structure, giving the molecule distinct properties compared to a simple hydrocarbon.

Substituents

Substituents are atoms or groups of atoms that are attached to the main carbon chain or structure in organic molecules. These play a critical role in defining the characteristics and reactivity of the molecule. In our example, 2-bromo-2-chloro-3-methylpentane, each substituent contributes uniquely to the molecule:

• Bromine and chlorine are halogen substituents, which introduce elements of polarity and impact the boiling and melting points of the molecule.
• The methyl group, a simple carbon-based substituent, adds to the complexity by influencing the molecule's branching and stability.

The position and type of substituents affect not just physical properties like solubility and boiling point, but also how the molecule interacts in chemical reactions. In synthesis, medicines, and materials science, the choice and positioning of substituents are essential for achieving desired properties and outcomes.

Hydrocarbons

Hydrocarbons, composed solely of hydrogen and carbon atoms, form the basis of organic chemistry. These compounds serve as the foundation upon which more complex molecules are built. They can be categorized into alkanes, alkenes, and alkynes, based on the types of bonds between carbon atoms:

• Alkanes have only single bonds and are generally referred to as saturated hydrocarbons. Pentane, the base structure for our molecule, is an alkane, featuring straight chain of five carbons.
• Alkenes and alkynes, with double or triple carbon-carbon bonds, are unsaturated hydrocarbons.

In our molecule, 2-bromo-2-chloro-3-methylpentane, the pentane chain is a straightforward example of an alkane. Hydrocarbons like pentane form a backbone to which functional groups and substituents are added to create more diverse and functional compounds. This versatility makes hydrocarbons crucial in numerous applications, from fuels to petrochemicals, influencing fields like energy and material sciences significantly.