Problem 4

Question

Consider each of the following physical characteristics of certain amides. a. Carboxamides have rotational barriers on the order of \(20 \mathrm{kcal} / \mathrm{mol}\) for the process: [R]C(=O)N(C)C C=CC(=O)N(C)CC(=O)c1ccccc1 Develop a structural explanation for the barrier both in resonance and MO terminology.

Step-by-Step Solution

Verified
Answer
The rotational barrier in amides is due to resonance and MO overlap.
1Step 1: Understanding the Molecular Structure of Amides
Amides typically consist of a carbonyl group (C=O) bonded to a nitrogen atom (N). In the given structure, the amide bond is represented by \( C(=O)N(C)\). Here, the nitrogen is also bonded to alkyl or aryl groups, which can rotate around the \( C-N \) bond.
2Step 2: Exploring the Concept of Rotational Barriers
Rotational barriers refer to the energy required to rotate around a particular bond. In the case of amides, the \( C-N \) bond has a significant rotational barrier of approximately 20 kcal/mol. This is because the rotation disrupts the resonance stabilization between the oxygen, carbon, and nitrogen atoms.
3Step 3: Describing Resonance Contribution
In resonance terminology, the lone pair on the nitrogen can delocalize and interact with the carbonyl group, forming a partial double bond character between C=N. This resonance stabilization reduces flexibility around the \( C-N \) bond, leading to a higher rotational barrier.
4Step 4: Introducing MO Theory Explanation
From a molecular orbital (MO) perspective, the overlap of the p-orbital on nitrogen with the p-orbital of the carbonyl carbon creates a pi-bonding interaction. This overlap enhances the double bond character of \( C-N \), thus increasing the energy required to rotate this bond.

Key Concepts

Resonance StabilizationMolecular Orbital TheoryCarbon-Nitrogen BondStructural Explanation
Resonance Stabilization
In amides, resonance stabilization is a key concept that explains the rotational barriers around the carbon-nitrogen bond. Resonance occurs when electrons can be delocalized among multiple atoms, creating multiple valid structures for the same molecule. For amides, the lone pair of electrons on the nitrogen atom participates in resonance with the carbonyl group. - This resonance results in a partial double bond character between the carbon and nitrogen atoms. - The double bond character restricts rotation, as double bonds are generally shorter and stronger than single bonds. - As a result, greater energy is needed to break this partial double bond during rotation, which is observed as a high rotational barrier. Understanding resonance helps explain why the rotational barrier for carboxamides is around 20 kcal/mol. The stabilization due to resonance means that it takes more energy to disturb the electron delocalization that makes the amide bond stable and rigid.
Molecular Orbital Theory
Molecular Orbital (MO) Theory provides another lens through which we can understand the rotation barriers observed in amides. This approach focuses on the interaction of atomic orbitals to form molecular orbitals, which can be bonding, antibonding, or non-bonding. - In the context of amides, the p-orbital of nitrogen overlaps with the p-orbital of the carbonyl carbon. - This overlap forms a pi-bonding interaction, enhancing the partial double bond character of the carbon-nitrogen bond. - The pi-bond formation increases the stability of the molecule and necessitates considerably higher energy for rotation. Thus, MO theory explains the significant energy needed because breaking the pi-bonding interaction to allow rotation requires overcoming the stabilization it provides. This stabilizing interaction means that non-rotated, resonance-stabilized conformations are preferentially occupied.
Carbon-Nitrogen Bond
The carbon-nitrogen (C-N) bond in amides is central to their high rotational barriers. This bond expresses characteristics that lie between a typical single and double bond due to resonance and molecular orbital interactions. - The partial double bond character makes the C-N bond stronger and shorter than a typical single bond. - It restricts the freedom of rotation, requiring substantial energy to overcome this bond's rigidity. This rigidity is crucial for various biochemical processes, providing structural integrity to proteins and peptides where amides form the backbone of the polypeptide chains. Understanding the nature of the C-N bond helps in predicting the behavior of molecules during chemical reactions and in biological systems.
Structural Explanation
From a structural standpoint, the rigidity in amides is explained by the molecular interactions and character of their bonds. The carboxamide structure involves a carbonyl group directly bonded to a nitrogen. - The carbonyl carbon is electrophilic, meaning it tends to attract electrons. - This attraction facilitates electron delocalization with the nitrogen. - As a result, the structure stabilizes through a partial double-bond character between C and N. Visualizing this, amides can be depicted as a blend of forms where electron density is shared, reducing the likelihood of free rotation. The structural explanation of amide rigidity plays a crucial role in molecular design and synthesis, allowing chemists to predict and manipulate the physical and chemical properties of complex molecules efficiently.