Problem 3
Question
\(\mathrm{C}_{3} \mathrm{H}_{3}+\mathrm{Cl}_{2} \stackrel{\text { Light }}{\longrightarrow} \mathrm{C}_{3} \mathrm{H}_{7} \mathrm{Cl}+\mathrm{HCl}\) is an example of (a) elimination (b) substitution (c) addition (d) rearrangement reaction
Step-by-Step Solution
Verified Answer
This is a substitution reaction.
1Step 1: Identify the type of reaction
The reaction provided is \( \mathrm{C}_{3} \mathrm{H}_{3}+\mathrm{Cl}_{2} \stackrel{\text { Light}}{\longrightarrow} \mathrm{C}_{3} \mathrm{H}_{7} \mathrm{Cl}+\mathrm{HCl} \). We start by analyzing the changes happening to the molecules. Here, chlorine \( (\mathrm{Cl}_2) \) interacts with \( \mathrm{C}_{3} \mathrm{H}_{3} \), replacing hydrogen atoms and forming \( \mathrm{C}_{3} \mathrm{H}_7\mathrm{Cl} \). There is no change in the framework of the carbon atoms but there is an exchange of hydrogen with chlorine.
2Step 2: Assess the options
Given the options: (a) elimination, (b) substitution, (c) addition, (d) rearrangement reaction, we need to match the process with the correct terminology. Here we observe that a chlorine atom is replacing a hydrogen atom - this is indicative of a substitution reaction. In substitution reactions, one group is replaced by another without altering the overall molecular framework significantly.
3Step 3: Conclusion of reaction type
Since the reaction involves the replacement of hydrogen with chlorine, keeping the backbone of the hydrocarbon unchanged, the reaction is best classified as a substitution reaction.
Key Concepts
Chemical Reaction ClassificationOrganic ChemistryReaction Mechanisms
Chemical Reaction Classification
In the broad realm of chemistry, chemical reactions are classified based on how atoms in molecules interact and transform during a reaction. One such classification divides reactions into categories like substitution, addition, elimination, and rearrangement. These categories help chemists understand and predict the changes that molecules undergo.
- **Addition reactions** involve the joining of two or more molecules, increasing the molecular complexity without loss of atoms. - **Elimination reactions** are the opposite, where a molecule loses elements, often simplifying the structure. - **Rearrangement reactions** see the actual structure of the molecule change, with atoms or groups shifting places without addition or removal of atoms from the molecule. - **Substitution reactions**, like the example in the exercise, involve swapping one atom or group within a molecule for another without changing the fundamental structure of the molecule.
Each type of reaction provides insights into how chemicals interact and transform, paving the way for applications in fields like pharmaceuticals, materials science, and biotechnology.
- **Addition reactions** involve the joining of two or more molecules, increasing the molecular complexity without loss of atoms. - **Elimination reactions** are the opposite, where a molecule loses elements, often simplifying the structure. - **Rearrangement reactions** see the actual structure of the molecule change, with atoms or groups shifting places without addition or removal of atoms from the molecule. - **Substitution reactions**, like the example in the exercise, involve swapping one atom or group within a molecule for another without changing the fundamental structure of the molecule.
Each type of reaction provides insights into how chemicals interact and transform, paving the way for applications in fields like pharmaceuticals, materials science, and biotechnology.
Organic Chemistry
Organic chemistry is the branch of chemistry dedicated to studying carbon-containing compounds and their interactions. It covers a vast range of molecules, from simple hydrocarbons to complex biomolecules like proteins and DNA. Understanding these interactions is crucial for developing new drugs, materials, and even energy sources.
The heart of organic chemistry lies in how carbon atoms form stable bonds with elements like hydrogen, oxygen, nitrogen, and the halogens, including chlorine. This capacity for bonding makes organic compounds incredibly diverse. The example reaction, \[\mathrm{C}_3\mathrm{H}_3+\mathrm{Cl}_2 \longrightarrow \mathrm{C}_3\mathrm{H}_7\mathrm{Cl}+\mathrm{HCl}\]illustrates this diversity in real-time. In this substitution reaction, an organic molecule interacts with chlorine, showcasing the versatility of carbon's bonding capability.
Organic reactions can be driven by different conditions - heat, light, or catalysts, each offering unique pathways. In the exercise, the reaction proceeds under the influence of light, which provides the energy necessary for the chlorine molecules to effectively substitute the hydrogen atoms in the carbon chain.
The heart of organic chemistry lies in how carbon atoms form stable bonds with elements like hydrogen, oxygen, nitrogen, and the halogens, including chlorine. This capacity for bonding makes organic compounds incredibly diverse. The example reaction, \[\mathrm{C}_3\mathrm{H}_3+\mathrm{Cl}_2 \longrightarrow \mathrm{C}_3\mathrm{H}_7\mathrm{Cl}+\mathrm{HCl}\]illustrates this diversity in real-time. In this substitution reaction, an organic molecule interacts with chlorine, showcasing the versatility of carbon's bonding capability.
Organic reactions can be driven by different conditions - heat, light, or catalysts, each offering unique pathways. In the exercise, the reaction proceeds under the influence of light, which provides the energy necessary for the chlorine molecules to effectively substitute the hydrogen atoms in the carbon chain.
Reaction Mechanisms
Reaction mechanisms detail the step-by-step process that leads to the transformation of reactants into products. They help us visualize how molecules collide, rearrange, break, or form bonds. In organic chemistry, understanding these mechanisms can be particularly complex due to the variety of pathways molecules can take.
In a substitution reaction, like the one from the exercise, the mechanism typically involves several stages:
In a substitution reaction, like the one from the exercise, the mechanism typically involves several stages:
- Initiation: Light energy breaks the chlorine molecule into reactive chlorine atoms or radicals.
- Propagation: These radicals interact with the organic molecules, substituting hydrogen atoms while forming new substances like \(\mathrm{HCl}\).
- Termination: The radicals eventually combine to form stable products, ending the chain reaction.
Other exercises in this chapter
Problem 1
C-X bond is strongest in (a) \(\mathrm{CH}_{3} \mathrm{Br}\) (b) \(\mathrm{CH}_{3} \mathrm{Cl}\) (c) \(\mathrm{CH}_{3} \mathrm{I}\) (d) \(\mathrm{CH}_{3} \mathr
View solution Problem 2
C-Cl bond of chlorobenzene in comparison to \(\mathrm{C}-\mathrm{Cl}\) bond in methyl chloride is (a) shorter and weaker (b) shorter and stronger (c) longer and
View solution Problem 4
The starting substance for the preparation of iodoform is any one of the following, except (a) \(\mathrm{CH}_{3} \mathrm{CH}(\mathrm{OH}) \mathrm{CH}_{3}\) (b)
View solution Problem 5
The following structural formula refers to Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1 (a) DDT (b) RNA (c) DNA (d) \(\mathrm{BHC}\)
View solution