Problem 2
Question
C-Cl bond of chlorobenzene in comparison to \(\mathrm{C}-\mathrm{Cl}\) bond in methyl chloride is (a) shorter and weaker (b) shorter and stronger (c) longer and weaker (d) longer and stronger
Step-by-Step Solution
Verified Answer
(b) shorter and stronger
1Step 1: Understanding Bond Types
The C-Cl bond in chlorobenzene is part of an aromatic ring, while in methyl chloride it is part of an alkyl group. Aromatic rings have resonance, which can affect bond properties.
2Step 2: Resonance in Chlorobenzene
In chlorobenzene, the \( ext{C-Cl}\) bond is affected by the resonance of the benzene ring. This resonance results in partial double bond character of the \( ext{C-Cl}\) bond, leading to a shorter bond length compared to a typical single bond.
3Step 3: Bond Strength Considerations
The partial double bond character due to resonance also makes the \( ext{C-Cl}\) bond in chlorobenzene stronger because it requires more energy to break a bond with a double bond character than a single bond.
4Step 4: Methyl Chloride Comparison
The \( ext{C-Cl}\) bond in methyl chloride is a typical single bond with no resonance effects, making it longer and weaker compared to the bond in chlorobenzene.
5Step 5: Identifying the Correct Option
Since the \( ext{C-Cl}\) bond in chlorobenzene is shorter and stronger due to resonance, the correct answer is (b) shorter and stronger.
Key Concepts
C-Cl bondresonance in aromatic compoundsbond length and strengthmethyl chloride comparison
C-Cl bond
The covalent bond between carbon and chlorine, known as the C-Cl bond, can vary significantly depending on its chemical environment. In chlorobenzene, the C-Cl bond is uniquely influenced by the presence of an aromatic ring. This aromatic ring provides a framework where the electron density can be delocalized across multiple atoms.
Contrastingly, in methyl chloride, the C-Cl bond connects a methyl group to the chlorine atom. This bond in methyl chloride is simpler, lacking the complex interactions present in aromatic systems. This sets the stage for understanding how different environments can significantly alter bond characteristics, such as length and strength.
Contrastingly, in methyl chloride, the C-Cl bond connects a methyl group to the chlorine atom. This bond in methyl chloride is simpler, lacking the complex interactions present in aromatic systems. This sets the stage for understanding how different environments can significantly alter bond characteristics, such as length and strength.
resonance in aromatic compounds
In chemistry, resonance refers to the delocalization of electrons across multiple atoms, so that a bond can exhibit characteristics of both single and double bonds.
In the case of aromatic compounds like chlorobenzene, resonance plays a crucial role. Here, the benzene ring allows electrons to move freely around the ring, creating a partial double bond character for the C-Cl bond.
This means that the bond is not a simple single bond, which results in a change in its properties. Specifically, the resonance in chlorobenzene reduces the bond length and increases its overall strength.
In the case of aromatic compounds like chlorobenzene, resonance plays a crucial role. Here, the benzene ring allows electrons to move freely around the ring, creating a partial double bond character for the C-Cl bond.
This means that the bond is not a simple single bond, which results in a change in its properties. Specifically, the resonance in chlorobenzene reduces the bond length and increases its overall strength.
bond length and strength
Bond length and bond strength are closely interconnected. Generally, when a bond exhibits partial double bond characteristics due to resonance, as seen with the C-Cl bond in chlorobenzene, it becomes shorter and stronger.
The shorter bond length is due to increased electron overlap between the carbon and chlorine atoms, reinforcing the bond.
Furthermore, more energy is required to break a bond containing double bond characteristics compared to a simple single bond. Therefore, the C-Cl bond in chlorobenzene is both shorter and stronger than in non-resonant environments.
The shorter bond length is due to increased electron overlap between the carbon and chlorine atoms, reinforcing the bond.
Furthermore, more energy is required to break a bond containing double bond characteristics compared to a simple single bond. Therefore, the C-Cl bond in chlorobenzene is both shorter and stronger than in non-resonant environments.
methyl chloride comparison
In methyl chloride, the C-Cl bond is a typical single covalent bond. Since it lacks the influence of resonance, the bond is a straightforward single bond without double bond character.
This leads to a longer bond length because there is less electron overlap between the atoms compared to what occurs in chlorobenzene.
Consequently, the bond in methyl chloride is weaker, requiring less energy to break.
This leads to a longer bond length because there is less electron overlap between the atoms compared to what occurs in chlorobenzene.
Consequently, the bond in methyl chloride is weaker, requiring less energy to break.
- Chlorobenzene exhibits a shorter and stronger C-Cl bond due to resonance.
- Methyl chloride has a longer and weaker C-Cl bond given its lack of resonance effects.
Other exercises in this chapter
Problem 1
C-X bond is strongest in (a) \(\mathrm{CH}_{3} \mathrm{Br}\) (b) \(\mathrm{CH}_{3} \mathrm{Cl}\) (c) \(\mathrm{CH}_{3} \mathrm{I}\) (d) \(\mathrm{CH}_{3} \mathr
View solution Problem 3
\(\mathrm{C}_{3} \mathrm{H}_{8}+\mathrm{Cl}_{2} \stackrel{\text { Light }}{\longrightarrow} \mathrm{C}_{3} \mathrm{H}_{7} \mathrm{Cl}+\mathrm{HCl}\) is an examp
View solution Problem 4
The starting substance for the preparation of iodoform is any one of the following, except (a) \(\mathrm{CH}_{3} \mathrm{CH}(\mathrm{OH}) \mathrm{CH}_{3}\) (b)
View solution Problem 5
The following structural formula refers to Clc1ccc(C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl)cc1 (a) DDT (b) RNA (c) DNA (d) \(\mathrm{BHC}\)
View solution