Problem 16

Question

Interpret Chemical Structures Why is the name 3-butylpentane incorrect? Based on this name, write the structural formula for the compound. What is the correct lUPAC name for 3-butylpentane?

Step-by-Step Solution

Verified
Answer
The name 3-butylpentane is incorrect because the longest chain is 8 carbons, not 5. The correct IUPAC name is 3-methyloctane.
1Step 1: Understanding the Name
The name "3-butylpentane" implies a pentane (5-carbon) chain with a butyl (4-carbon) group attached to the third carbon. However, this naming suggests an incorrect structure as it disregards proper IUPAC nomenclature steps, which prioritize the longest carbon chain.
2Step 2: Drawing the Attempted Structure
Start by drawing a 5-carbon chain (pentane). Then, add a butyl group connected to the third carbon of this chain. The structure would look like this: CH3-CH(CH2CH2CH2CH3)-CH2-CH2-CH3.
3Step 3: Determining the Longest Carbon Chain
Identify the longest continuous carbon chain in the attempted structure. When you count, it stretches to 8 carbons, forming an octane chain, rather than just a pentane.
4Step 4: Correcting the Structure and Naming
Since the longest chain is actually 8 carbons, the base name should be derived from it: octane. The original butyl chain is part of this longest chain, making the additional group just a methyl group on the sixth carbon in the octane chain. Hence, the corrected structure is named 3-methyloctane.
5Step 5: Verifying The IUPAC Name
Check the IUPAC rules to ensure the longest chain is chosen, substituents are named alphabetically, and the lowest possible numbers are given to substituents. This confirms that the correct IUPAC name is indeed 3-methyloctane.

Key Concepts

Understanding Structural Formula in Organic ChemistryThe Role of Organic ChemistryIdentifying the Longest Carbon ChainDecoding Alkane Naming Rules
Understanding Structural Formula in Organic Chemistry
In organic chemistry, a structural formula serves as a detailed blueprint of a molecule. It consists of atomic symbols connected by lines, representing bonds between atoms. These diagrams help us visualize the exact arrangement of atoms in a compound.
For example, the structural formula of a simple alkane, pentane, would display five carbon atoms single-bonded in a straight chain with hydrogen atoms filling the remaining valences. Structural formulas are essential for understanding the specificity and uniqueness of organic compounds, as even small variations in structure can lead to different compounds.
  • To read a structural formula, start by recognizing the carbon chain.
  • Look for any branches or substituents.
  • Analyze the types of bonds; single, double, or triple.
Understanding structural formulas is the first step in mastering organic chemistry.
The Role of Organic Chemistry
Organic chemistry is the branch of chemistry that focuses on the study of carbon-containing compounds. Since carbon atoms can form long chains and complex structures, organic chemistry is crucial for developing an understanding of a vast array of substances, from fuels to pharmaceuticals.
In this field, recognizing and naming compounds is essential. This process is standardized by the International Union of Pure and Applied Chemistry (IUPAC) to ensure consistent communication across the scientific community.
Organic compounds are categorized based on their functional groups and carbon arrangements. Mastering organic chemistry involves learning about these various groups and understanding how they contribute to the properties of compounds.
Identifying the Longest Carbon Chain
Determining the longest carbon chain in a molecule is a key step in naming organic compounds. The longest carbon chain determines the base name of the compound in IUPAC nomenclature.
In the example of 3-butylpentane, initially, it appeared as if the main chain was a five-carbon pentane. However, on closer inspection, the longest continuous chain is found to be eight carbons, forming an octane.
To identify the longest chain:
  • Look for the longest path of connected carbon atoms without lifting your pen.
  • Ensure it is a continuous line of bonds.
  • Even if a branching group like butyl seems prominent, prioritize the longest chain for correct naming.
  • This chain becomes the primary structure for naming, and substituents are named and numbered around it.
This technique ensures accuracy in the representation and naming of organic compounds.
Decoding Alkane Naming Rules
The IUPAC system employs specific rules for naming alkanes to avoid ambiguity. Here are the basic alkane naming rules simplified:
1. **Find the Longest Continuous Chain:** As stated, determine the main carbon chain; this gives the backbone name (e.g., octane for an 8-carbon chain).
2. **Identify and Name Substituents:** These are groups attached to the main chain, like methyl (CH₃-) or ethyl (C₂H₅-).
3. **Number the Chain:** Start numbering from the end nearest a substituent to give the lowest position numbers.
4. **Assemble the Name:** Combine the substituent names and their positions with the name of the longest chain (e.g., 3-methyloctane).
These systematic rules ensure clarity and consistency in organic chemistry. By following these steps, one guarantees the accurate communication of a compound’s structure through its name.