Problem 134
Question
In the following groups: -OAc (I), \(\quad\)-OMe (II) \(-\mathrm{OSO}_{2} \mathrm{Me}\) (III), \(\quad-\mathrm{OSO}_{2} \mathrm{CF}_{3}\) (IV) the order of the leaving group ability is (a) \(\mathrm{I}>\mathrm{II}>\mathrm{III}>\mathrm{IV}\) (b) \(\mathrm{IV}>\mathrm{III}>\mathrm{I}>\mathrm{II}\) (c) \(\mathrm{III}>\mathrm{II}>\mathrm{I}>\mathrm{IV}\) (d) II \(>\mathrm{III}>\mathrm{IV}>\mathrm{I}\).
Step-by-Step Solution
Verified Answer
The order is (b): IV > III > I > II.
1Step 1: Define Leaving Group Ability
The ability of a group to be a good leaving group is determined by how easily the group can accept electrons as it departs. A more stable leaving group in solution signifies a better leaving group. Generally, weak bases and those groups that stabilize the negative charge are better leaving groups.
2Step 2: Analyze Leaving Groups
For each group, examine the structural features and the stability of the leaving group:
- **-OAc (I)**: Acetate anion is moderately stabilized by resonance.
- **-OMe (II)**: Methoxy is a poor leaving group since methoxide is a strong base.
- **-OSO₂Me (III)**: This group forms the mesylate anion, a good leaving group due to resonance stabilization and the presence of the weaker base.
- **-OSO₂CF₃ (IV)**: This triflate group forms the triflate anion, which is an excellent leaving group, highly stabilized by resonance and inductive effects due to the strongly electron-withdrawing CF₃ group.
3Step 3: Rank Leaving Groups
Order the groups based on their stability and ability to leave:
1. **-OSO₂CF₃ (IV)** because it forms the highly stable triflate anion.
2. **-OSO₂Me (III)** forms the mesylate, also a good leaving group but less stable than triflate.
3. **-OAc (I)** because acetate anion is moderately stable due to resonance, but not as stable as IV or III.
4. **-OMe (II)** because the methoxide anion is a strong base and thus a poor leaving group.
4Step 4: Choose the Correct Answer
Based on the ranking, the correct order of leaving group ability is **IV > III > I > II**. This corresponds to option (b).
Key Concepts
Leaving Group AbilityResonance StabilizationInductive Effects
Leaving Group Ability
In organic chemistry, the concept of leaving group ability is important when understanding reaction mechanisms, especially in nucleophilic substitution reactions. A leaving group is an atom or group that detaches from the parent molecule during a chemical reaction. Its ability to leave effectively depends largely on its stability upon departure.
- Stable leaving groups can better accommodate the negative charge they receive when they leave. This often means they are weak bases.
- A weak base is less likely to recombine with the parent molecule, making it a more effective leaving group.
Consider these properties while evaluating leaving group ability:
- Structural stability in solvation: The more stable the ion in a solvent, the better the leaving group.
- The tendency to stabilize negative charge: Groups that can delocalize or reduce the intensity of the charge make for better leaving groups.
Resonance Stabilization
Resonance stabilization is a key factor influencing the leaving group ability in organic molecules. It involves the delocalization of electrons across a molecule, enhancing the stability of the ion or group resulting from the leaving group.
Resonance allows for:
- Spread of electronic charge over multiple atoms, which reduces the energy and instability associated with any single charged atom.
- Increased stability of ions like acetate and triflate, which have resonance structures that help distribute the negative charge.
Inductive Effects
Inductive effects refer to the transmission of charge through a chain of atoms, which can influence a molecule's stability and reactivity. In the context of leaving groups, inductive effects can significantly affect how good a group is at departing.
Key Points about Inductive Effects include:
- Electron-withdrawing groups imbue stability to a compound through the pull on electron density, often leading to stronger inductive effects.
- In groups like triflate (-OSO₂CF₃), the electron-withdrawing nature of the CF₃ (trifluoromethyl) group exerts a strong inductive effect, greatly stabilizing the anion after the group leaves.
- This increased stability through electron-withdrawal means such groups can leave more readily compared to groups like methoxy (-OMe), which not only lack this stabilization but are also strong donors due to opposite inductive effects.
Other exercises in this chapter
Problem 132
Consider the following carbocations and arranged them in the increasing order of their stability: (1) (2) \(\mathrm{CH}_{3}-\mathrm{CH}-\mathrm{CH}_{3}\) (3) \(
View solution Problem 133
Identify the correct order of reactivity in electrophilic substitution reactions of the following compounds: c1ccccc1 Cc1ccccc1 Clc1ccccc1 O=[N+]([O-])c1ccccc1
View solution Problem 135
The reaction, [R]c1ccc(C(Br)Nc2ccccc2)cc1 is influenced by the hyperconjugative effect of group R. Now if R sequentially is I. \(\mathrm{CH}_{3}\) II. \(\mathrm
View solution Problem 136
Consider the following amines: (1) \(\mathrm{C}_{6} \mathrm{H}_{3}-\mathrm{NH}_{2}\) (2) \(0-\mathrm{NO}_{2}-\mathrm{C}_{6} \mathrm{H}_{4}-\mathrm{NH}_{2}\) (3)
View solution