Problem 1

Question

Indicate whether the following pairs of compounds are identical, enantiomers, diastereomers, or structural isomers. a. N C ( C O ) C ( O ) C ( C b. CC1(C)C=CCCC1 CC1C=CCCC1 c. O=C1CC2CCC1C2 and O=C1CC2CCC1C2 d. CC(C)(C)CCCS(=O)CCC(C)(C)C e. O=C1C=CC(Cl)C1 and O=C1C=CC(Cl)C1 f. Cl C 1 C C ( Br ) C ( and C C 1 C C C C ( 2.2. Use the sequence rule to specify the configuration of the stereogenic center in each of the following molecules.

Step-by-Step Solution

Verified
Answer
The pairs are: a. identical, b. structural isomers, c. identical, d. not provided, e. identical, f. not provided. For stereochemistry, use R/S configuration rules.
1Step 1: Identify the Compounds
First, we need to understand the problem by identifying the chemical structure of each compound using SMILES notation. List each given pair of SMILES strings and convert them to their respective chemical structures.
2Step 2: Analyze the SMILES
Convert each SMILES notation into a chemical structure. SMILES (Simplified Molecular Input Line Entry System) is a way to describe a structure. For example, in pair b, 'CC1(C)C=CCCC1' is a cyclopentane with an isopropyl group. Note the different structural features, if any, in each pair.
3Step 3: Compare Structures
Evaluate each pair by comparing the drawn chemical structures. Determine if they are identical, enantiomers (stereoisomers that are mirror images but not identical), diastereomers (stereoisomers that are not mirror images), or structural isomers (same molecular formula, but different connectivity).
4Step 4: Evaluate Stereochemistry
Look for stereocenters in each compound. If present, determine the configuration as R or S using Cahn-Ingold-Prelog priority rules to differentiate between enantiomers and diastereomers.
5Step 5: Apply Sequence Rules
For any stereochemical center, apply the Cahn-Ingold-Prelog rules to assign R or S configuration. This involves identifying priority groups based on atomic numbers and analyzing which side the priority follows around the stereocenter.

Key Concepts

SMILES notationEnantiomersDiastereomersCahn-Ingold-Prelog rules
SMILES notation
SMILES (Simplified Molecular Input Line Entry System) is a notation that allows the representation of a chemical structure using a short ASCII string. It is especially useful because it is quick and easy to read or type compared to drawing the full chemical structure.

SMILES captures the molecular topology, that is, how atoms are bonded to each other, rather than the geometric arrangement. Here, atoms are represented by their chemical symbols, and bonds are often inferred from adjacencies or specific symbols:
  • Single bonds are usually omitted (CC signifies two carbon atoms with a single bond).
  • Double bonds are represented by '=' (C=C) and triple bonds by '#' (C#C).
  • Rings are denoted by numbers. For instance, 'C1' at both ends of a sequence indicates these carbon atoms are bonded to close a ring.
SMILES is flexible and versatile, which is why it is widely used in cheminformatics to input and store molecule data efficiently.

In exercises like the one provided, converting SMILES to a chemical structure is vital to understanding and comparing the molecular geometry of isomers.
Enantiomers
Enantiomers are a type of stereoisomer, which means they have the same structural formula but differ in the orientation of the atoms in space. They are mirror images of each other, much like how your left and right hands are mirror images but cannot be superimposed.

A classic example involves a carbon atom bonded to four different groups, making it a chiral center. This chirality is what gives rise to enantiomers:
  • They have identical physical properties like melting point and boiling point.
  • They rotate plane-polarized light in opposite directions, one to the left (levorotatory) and the other to the right (dextrorotatory).
  • Enantiomers may behave differently in a biological system, as many biomolecules are chiral.
A typical task would be identifying enantiomers using the chemical structures obtained from SMILES notation and applying stereochemical concepts like the Cahn-Ingold-Prelog rules.
Diastereomers
Diastereomers are also stereoisomers, however unlike enantiomers, they are not mirror images of each other. They arise when there are two or more stereocenters in a molecule.

For diastereomers:
  • They have different physical and chemical properties, making them easier to distinguish.
  • Examples include compounds having multiple chiral centers with at least one center having different configurations.
It is crucial to examine all stereocenters using methods like SMILES notation to properly identify diastereomers. Their non-mirror image relationship leads to diverse characteristics and applications in chemistry.
Cahn-Ingold-Prelog rules
The Cahn-Ingold-Prelog (CIP) priority rules are used to assign stereo configurations (R or S) to chiral centers within molecules.

Here is how the rules simplify the process:
  • Identify the chiral center and the groups attached.
  • Rank these groups based on atomic number—the higher the atomic number, the higher the priority.
  • If two atoms are the same, move to the next atom bonded to each and compare their priorities.
The configuration is then assigned looking down from the lowest priority group.
- If the order of the highest priorities goes clockwise, it is labeled as 'R' (rectus). - If counterclockwise, it is 'S' (sinister).
This systematic approach allows chemists to consistently identify and differentiate enantiomers even when viewing complex molecular structures.