Problem 1
Question
Draw the full structure of L-alanyl-L-phenylalanyl-glycine.
Step-by-Step Solution
Verified Answer
Alanine-Phe-Gly is a tripeptide: NH2-CH(CH3)-CO-NH-CH(C6H5CH2)-CO-NH-CH2-COOH.
1Step 1: Identify the Amino Acids
The tripeptide L-alanyl-L-phenylalanyl-glycine is composed of three amino acids: L-alanine (Ala), L-phenylalanine (Phe), and glycine (Gly). It is important to know the structure of these amino acids in order to draw the full peptide.
2Step 2: Understand the Peptide Bond Formation
A peptide bond forms between the carboxyl group (-COOH) of one amino acid and the amino group (-NH2) of another, releasing a molecule of water in the process. In this tripeptide, peptide bonds will form between alanine and phenylalanine, and between phenylalanine and glycine.
3Step 3: Draw the Structure of L-Alanine
Draw the structure of L-alanine: - Amino group: \(-NH_2\)- Alpha carbon: Connected to an hydrogen and a methyl group \(-CH_3\)- Carboxyl group: \(-COOH\)This serves as the starting point for the peptide chain.
4Step 4: Draw the Structure of L-Phenylalanine
Draw the structure of L-phenylalanine:- Connect the α-amino group \(-NH\)of phenylalanine to the carboxyl group of alanine to form a peptide bond.- The side chain for phenylalanine is a benzyl group (\(-CH_2-C_6H_5\)).
5Step 5: Draw the Structure of Glycine
Draw the structure of glycine:
- Connect the α-amino group of glycine to the carboxyl group of phenylalanine to form another peptide bond.
- Glycine has the simplest side chain which is just an hydrogen atom.
6Step 6: Combine and Verify
Combine the structures of alanine, phenylalanine, and glycine, ensuring peptide bonds correctly link them in sequence. Verify that each bond is correctly formed and the correct functional groups remain (e.g., the N-terminus and C-terminus).
Key Concepts
Amino AcidsPeptide Bond FormationL-Alanine
Amino Acids
Amino acids are the building blocks of proteins and play a crucial role in various biological processes. They are organic compounds composed of an amino group (-NH2), a carboxyl group (-COOH), a hydrogen atom, and a distinctive side chain (R group) which all are connected to a central alpha carbon.
These components give amino acids their unique characteristics. There are 20 standard amino acids classified based on the nature of their side chain, which can be anything from a simple hydrogen atom to more complex ring structures.
These components give amino acids their unique characteristics. There are 20 standard amino acids classified based on the nature of their side chain, which can be anything from a simple hydrogen atom to more complex ring structures.
- Aliphatic amino acids like glycine have simple side chains.
- Aromatic amino acids such as phenylalanine have ring structures in their side chains.
- The side chain impacts the chemical properties and functionality of each amino acid, contributing to the protein's overall structure and function.
Peptide Bond Formation
Peptide bond formation is a key chemical reaction that links amino acids together to form proteins. This process occurs through a dehydration synthesis reaction, which involves the removal of a water molecule.
The carboxyl group of one amino acid reacts with the amino group of another, forming a covalent bond known as a peptide bond.
The carboxyl group of one amino acid reacts with the amino group of another, forming a covalent bond known as a peptide bond.
- This type of bond is strong and stable, providing the backbone for proteins.
- The result of peptide bond formation is a dipeptide, tripeptide, or polypeptide, depending on the number of amino acids involved.
- Each peptide bond formed brings amino acids closer together, aiding in the creation of complex protein structures.
L-Alanine
L-Alanine is a stereoisomer of the amino acid alanine and is one of the most common amino acids found in proteins. L-Alanine is characterized by its simple structure. Its side chain consists of a methyl group, making it a nonpolar, aliphatic amino acid.
The ease of L-Alanine in forming peptide bonds makes it a vital component in many biological functions, illustrating its crucial role in biochemistry.
- It has the chemical formula \( C_3H_7NO_2 \).
- The amino group (-NH2), carboxyl group (-COOH), and methyl group are bound to the central alpha carbon.
The ease of L-Alanine in forming peptide bonds makes it a vital component in many biological functions, illustrating its crucial role in biochemistry.
Other exercises in this chapter
Problem 2
What is unique about glycine compared with other naturally-occurring amino acids?
View solution Problem 3
Identify the intermolecular/intramolecular interactions that are possible for the side chains of the following amino acids; serine, phenylalanine, glycine, lysi
View solution Problem 4
The chains of several cell membrane-bound proteins wind back and forth through the cell membrane, such that some parts of the protein structure are extracellula
View solution